3-(2-hydroxy-4-methoxyphenyl)-7-methoxy-4H-chromen-4-one
| Internal ID | c91c11d9-32f5-4062-b590-9c3926281e4a |
| Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > O-methylated isoflavonoids > 7-O-methylated isoflavonoids > 7-O-methylisoflavones |
| IUPAC Name | 3-(2-hydroxy-4-methoxyphenyl)-7-methoxychromen-4-one |
| SMILES (Canonical) | COC1=CC(=C(C=C1)C2=COC3=C(C2=O)C=CC(=C3)OC)O |
| SMILES (Isomeric) | COC1=CC(=C(C=C1)C2=COC3=C(C2=O)C=CC(=C3)OC)O |
| InChI | InChI=1S/C17H14O5/c1-20-10-3-5-12(15(18)7-10)14-9-22-16-8-11(21-2)4-6-13(16)17(14)19/h3-9,18H,1-2H3 |
| InChI Key | ZQOPJNNVXTYJMC-UHFFFAOYSA-N |
| Popularity | 6 references in papers |
| Molecular Formula | C17H14O5 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.08412354 g/mol |
| Topological Polar Surface Area (TPSA) | 65.00 Ų |
| XlogP | 2.80 |
| 3-(2-hydroxy-4-methoxyphenyl)-7-methoxy-4H-chromen-4-one |
| 4H-1-benzopyran-4-one, 3-(2-hydroxy-4-methoxyphenyl)-7-methoxy- |
| 2'-Hydroxy-7,4-dimethoxyisoflavone |
| SCHEMBL2971118 |
| 4',7-dimethoxy-2'-isoflavonol |
| DTXSID00349103 |
| InChI=1/C17H14O5/c1-20-10-3-5-12(15(18)7-10)14-9-22-16-8-11(21-2)4-6-13(16)17(14)19/h3-9,18H,1-2H |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.56% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.10% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.11% | 98.95% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 94.76% | 91.49% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.17% | 99.15% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.54% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.06% | 86.33% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 89.91% | 90.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.97% | 89.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.79% | 98.75% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.42% | 99.17% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 86.28% | 93.31% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.57% | 99.23% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 81.58% | 93.65% |
| CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 81.50% | 80.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Pycnanthus angolensis |
| Virola surinamensis |
| PubChem | 643008 |
| LOTUS | LTS0129470 |
| wikiData | Q82124160 |