(1,4a-Dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthren-1-yl)methyl 2-methylbut-2-enoate
Internal ID | 4657fae6-9919-4bb0-bc37-1f5bfb913331 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | (1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthren-1-yl)methyl 2-methylbut-2-enoate |
SMILES (Canonical) | CC=C(C)C(=O)OCC1(CCCC2(C1CC=C3C2CCC(=C3)C(C)C)C)C |
SMILES (Isomeric) | CC=C(C)C(=O)OCC1(CCCC2(C1CC=C3C2CCC(=C3)C(C)C)C)C |
InChI | InChI=1S/C25H38O2/c1-7-18(4)23(26)27-16-24(5)13-8-14-25(6)21-11-9-19(17(2)3)15-20(21)10-12-22(24)25/h7,10,15,17,21-22H,8-9,11-14,16H2,1-6H3 |
InChI Key | RBSYKCMZHUVTOE-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H38O2 |
Molecular Weight | 370.60 g/mol |
Exact Mass | 370.287180451 g/mol |
Topological Polar Surface Area (TPSA) | 26.30 Ų |
XlogP | 6.60 |
There are no found synonyms. |
![2D Structure of (1,4a-Dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthren-1-yl)methyl 2-methylbut-2-enoate 2D Structure of (1,4a-Dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthren-1-yl)methyl 2-methylbut-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/4f8ed840-856b-11ee-acc7-e5efc37b684e.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.25% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.95% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.25% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 93.23% | 98.95% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 92.09% | 90.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.64% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.20% | 95.89% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 89.14% | 96.38% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.44% | 94.45% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.74% | 100.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 85.37% | 95.93% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.58% | 89.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.03% | 91.19% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.90% | 94.75% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.54% | 95.50% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.84% | 100.00% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.76% | 94.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.69% | 95.56% |
CHEMBL5028 | O14672 | ADAM10 | 82.06% | 97.50% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 81.57% | 82.69% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.53% | 91.07% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.47% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Solidago rugosa |
PubChem | 163048207 |
LOTUS | LTS0213767 |
wikiData | Q105233321 |