methyl (1R,2S,4aR,4bS,7R,8S,8aR,10aR)-7-[2-[2-(dimethylamino)ethoxy]-2-oxoethyl]-2-hydroxy-1,4a,8-trimethyl-9-oxo-3,4,4b,5,6,7,8,8a,10,10a-decahydro-2H-phenanthrene-1-carboxylate
Internal ID | a82316d6-0f48-4f23-a4a6-370a2698661e |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Isocopalane and spongiane diterpenoids |
IUPAC Name | methyl (1R,2S,4aR,4bS,7R,8S,8aR,10aR)-7-[2-[2-(dimethylamino)ethoxy]-2-oxoethyl]-2-hydroxy-1,4a,8-trimethyl-9-oxo-3,4,4b,5,6,7,8,8a,10,10a-decahydro-2H-phenanthrene-1-carboxylate |
SMILES (Canonical) | CC1C(CCC2C1C(=O)CC3C2(CCC(C3(C)C(=O)OC)O)C)CC(=O)OCCN(C)C |
SMILES (Isomeric) | C[C@H]1[C@H](CC[C@H]2[C@@H]1C(=O)C[C@@H]3[C@@]2(CC[C@@H]([C@]3(C)C(=O)OC)O)C)CC(=O)OCCN(C)C |
InChI | InChI=1S/C25H41NO6/c1-15-16(13-21(29)32-12-11-26(4)5)7-8-17-22(15)18(27)14-19-24(17,2)10-9-20(28)25(19,3)23(30)31-6/h15-17,19-20,22,28H,7-14H2,1-6H3/t15-,16+,17-,19+,20-,22+,24+,25+/m0/s1 |
InChI Key | PGXVHINAGNBIAC-BHVOIINCSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H41NO6 |
Molecular Weight | 451.60 g/mol |
Exact Mass | 451.29338803 g/mol |
Topological Polar Surface Area (TPSA) | 93.10 Ų |
XlogP | 3.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.43% | 96.09% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.60% | 90.17% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 92.83% | 83.82% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.49% | 91.11% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 89.36% | 90.08% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 89.34% | 97.33% |
CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 89.05% | 94.50% |
CHEMBL2581 | P07339 | Cathepsin D | 88.76% | 98.95% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 88.74% | 97.79% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 88.43% | 85.31% |
CHEMBL5028 | O14672 | ADAM10 | 86.67% | 97.50% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.53% | 91.19% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.59% | 95.89% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 85.09% | 96.90% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.95% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.95% | 97.09% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.31% | 94.33% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 82.69% | 95.93% |
CHEMBL1871 | P10275 | Androgen Receptor | 81.65% | 96.43% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.05% | 86.33% |
CHEMBL233 | P35372 | Mu opioid receptor | 80.85% | 97.93% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.81% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.78% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.51% | 89.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.19% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cenchrus americanus |
PubChem | 162845869 |
LOTUS | LTS0235868 |
wikiData | Q105208776 |