2-[4-Hydroxy-6-[[15-hydroxy-7-methoxy-7,9,13-trimethyl-6-[3-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutylidene]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-16-yl]oxy]-2-(hydroxymethyl)-5-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol
Internal ID | 573aecfd-ab2f-4283-8034-bf6e9a1e0e80 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
IUPAC Name | 2-[4-hydroxy-6-[[15-hydroxy-7-methoxy-7,9,13-trimethyl-6-[3-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutylidene]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-16-yl]oxy]-2-(hydroxymethyl)-5-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(OC(C(C2O)OC3C(C(C(C(O3)C)O)O)O)OC4CC5CCC6C(C5(CC4O)C)CCC7(C6CC8C7C(C(=CCC(C)COC9C(C(C(C(O9)CO)O)O)O)O8)(C)OC)C)CO)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2C(OC(C(C2O)OC3C(C(C(C(O3)C)O)O)O)OC4CC5CCC6C(C5(CC4O)C)CCC7(C6CC8C7C(C(=CCC(C)COC9C(C(C(C(O9)CO)O)O)O)O8)(C)OC)C)CO)O)O)O |
InChI | InChI=1S/C52H86O23/c1-20(19-67-46-39(62)38(61)35(58)30(17-53)72-46)8-11-32-52(6,66-7)45-29(70-32)15-26-24-10-9-23-14-28(27(55)16-51(23,5)25(24)12-13-50(26,45)4)71-49-44(75-48-41(64)37(60)34(57)22(3)69-48)42(65)43(31(18-54)73-49)74-47-40(63)36(59)33(56)21(2)68-47/h11,20-31,33-49,53-65H,8-10,12-19H2,1-7H3 |
InChI Key | WUEKEPWPDVRLTE-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C52H86O23 |
Molecular Weight | 1079.20 g/mol |
Exact Mass | 1078.55598899 g/mol |
Topological Polar Surface Area (TPSA) | 355.00 Ų |
XlogP | -1.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.15% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.92% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.17% | 97.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.51% | 97.25% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 91.38% | 95.93% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 90.70% | 95.58% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.35% | 94.45% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.21% | 100.00% |
CHEMBL237 | P41145 | Kappa opioid receptor | 88.19% | 98.10% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.66% | 95.89% |
CHEMBL1871 | P10275 | Androgen Receptor | 87.44% | 96.43% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.09% | 95.89% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 84.38% | 92.86% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 84.03% | 89.05% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.14% | 100.00% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 82.95% | 97.29% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 82.85% | 96.21% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 82.51% | 97.36% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.95% | 86.33% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.82% | 97.14% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 81.75% | 93.18% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.67% | 89.00% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.63% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.01% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Allium tuberosum |
PubChem | 85255091 |
LOTUS | LTS0129097 |
wikiData | Q105329587 |