2-(1,3-Benzodioxol-5-yl)-5,6-dimethoxy-7-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxy-2,3-dihydrochromen-4-one
Internal ID | d1874c3e-78e6-436b-84b0-a76318d48f45 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 2-(1,3-benzodioxol-5-yl)-5,6-dimethoxy-7-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxy-2,3-dihydrochromen-4-one |
SMILES (Canonical) | COC1=C(C=C2C(=C1OC)C(=O)CC(O2)C3=CC4=C(C=C3)OCO4)OC5C(C(C(C(O5)COC6C(C(C(C(O6)CO)O)O)O)O)O)O |
SMILES (Isomeric) | COC1=C(C=C2C(=C1OC)C(=O)CC(O2)C3=CC4=C(C=C3)OCO4)OC5C(C(C(C(O5)COC6C(C(C(C(O6)CO)O)O)O)O)O)O |
InChI | InChI=1S/C30H36O17/c1-39-27-17(7-16-20(28(27)40-2)12(32)6-14(44-16)11-3-4-13-15(5-11)43-10-42-13)45-30-26(38)24(36)22(34)19(47-30)9-41-29-25(37)23(35)21(33)18(8-31)46-29/h3-5,7,14,18-19,21-26,29-31,33-38H,6,8-10H2,1-2H3 |
InChI Key | OFDQNMIAAIPYCU-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H36O17 |
Molecular Weight | 668.60 g/mol |
Exact Mass | 668.19524968 g/mol |
Topological Polar Surface Area (TPSA) | 242.00 Ų |
XlogP | -1.60 |
There are no found synonyms. |
![2D Structure of 2-(1,3-Benzodioxol-5-yl)-5,6-dimethoxy-7-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxy-2,3-dihydrochromen-4-one 2D Structure of 2-(1,3-Benzodioxol-5-yl)-5,6-dimethoxy-7-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxy-2,3-dihydrochromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/4cf96420-85e0-11ee-8813-779fe6a2806f.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.04% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.59% | 96.09% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 97.43% | 94.80% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 96.61% | 96.77% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.35% | 85.14% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.51% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.15% | 97.09% |
CHEMBL2581 | P07339 | Cathepsin D | 92.52% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.27% | 86.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.79% | 96.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.50% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.44% | 89.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 89.33% | 92.62% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.86% | 94.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.56% | 100.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.47% | 99.17% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.97% | 95.89% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 82.01% | 96.21% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.88% | 94.73% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.59% | 90.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.45% | 95.89% |
CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 80.97% | 96.86% |
CHEMBL2535 | P11166 | Glucose transporter | 80.00% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Drimia indica |
PubChem | 163061216 |
LOTUS | LTS0103400 |
wikiData | Q105190868 |