3-[[(2S,3S,4S,5S,6S)-6-[3-[(2S,3R,4R,5S,6R)-6-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-7-hydroxy-2-(3,4,5-trihydroxyphenyl)chromenylium-5-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-3-oxopropanoic acid
Internal ID | 06b1cc79-8814-4443-bbdc-a10714b96a08 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Anthocyanidin 3-O-p-coumaroyl glycosides > Anthocyanidin 3-O-6-p-coumaroyl glycosides |
IUPAC Name | 3-[[(2S,3S,4S,5S,6S)-6-[3-[(2S,3R,4R,5S,6R)-6-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-7-hydroxy-2-(3,4,5-trihydroxyphenyl)chromenylium-5-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-3-oxopropanoic acid |
SMILES (Canonical) | C1=CC(=C(C=C1C=CC(=O)OCC2C(C(C(C(O2)OC3=C([O+]=C4C=C(C=C(C4=C3)OC5C(C(C(C(O5)COC(=O)CC(=O)O)O)O)O)O)C6=CC(=C(C(=C6)O)O)O)O)O)O)O)O |
SMILES (Isomeric) | C1=CC(=C(C=C1/C=C/C(=O)OC[C@@H]2[C@H]([C@H]([C@H]([C@@H](O2)OC3=C([O+]=C4C=C(C=C(C4=C3)O[C@H]5[C@H]([C@H]([C@@H]([C@@H](O5)COC(=O)CC(=O)O)O)O)O)O)C6=CC(=C(C(=C6)O)O)O)O)O)O)O)O |
InChI | InChI=1S/C39H38O23/c40-16-8-22-17(23(9-16)59-38-35(54)33(52)32(51)26(61-38)13-57-29(48)11-27(45)46)10-24(37(58-22)15-6-20(43)30(49)21(44)7-15)60-39-36(55)34(53)31(50)25(62-39)12-56-28(47)4-2-14-1-3-18(41)19(42)5-14/h1-10,25-26,31-36,38-39,50-55H,11-13H2,(H6-,40,41,42,43,44,45,46,47,49)/p+1/t25-,26+,31-,32-,33+,34-,35+,36-,38-,39-/m1/s1 |
InChI Key | BRCDVDQOVIAQRF-ZCBVMYEESA-O |
Popularity | 0 references in papers |
Molecular Formula | C39H39O23+ |
Molecular Weight | 875.70 g/mol |
Exact Mass | 875.18821249 g/mol |
Topological Polar Surface Area (TPSA) | 371.00 Ų |
XlogP | 0.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.88% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.15% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.51% | 89.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 96.13% | 96.00% |
CHEMBL3194 | P02766 | Transthyretin | 95.37% | 90.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.22% | 86.33% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 94.99% | 99.15% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.52% | 99.17% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 92.73% | 83.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.42% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.42% | 95.56% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 85.94% | 89.62% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.53% | 94.73% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.30% | 95.50% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 83.49% | 95.83% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 83.35% | 90.17% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 82.08% | 91.71% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.44% | 94.33% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 81.26% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 80.75% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.54% | 97.09% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 80.13% | 85.31% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Salvia splendens |
PubChem | 154497021 |
LOTUS | LTS0238006 |
wikiData | Q104944721 |