Acacetin 7-O-|A-D-glucuronopyranosyl-(1 inverted exclamation marku2)[|A-L-rhamnopyranosyl-(1 inverted exclamation marku6)]-|A-D-glucopyranoside
Internal ID | 9d5f1eec-8888-4829-893e-878e88b4d6dc |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | (2S,3S,4S,5R,6R)-6-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-2-[5-hydroxy-2-(4-methoxyphenyl)-4-oxochromen-7-yl]oxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-3-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
SMILES (Canonical) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=CC(=C4C(=C3)OC(=CC4=O)C5=CC=C(C=C5)OC)O)OC6C(C(C(C(O6)C(=O)O)O)O)O)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC3=CC(=C4C(=C3)OC(=CC4=O)C5=CC=C(C=C5)OC)O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)C(=O)O)O)O)O)O)O)O)O)O |
InChI | InChI=1S/C34H40O20/c1-11-21(37)23(39)27(43)32(49-11)48-10-19-22(38)25(41)30(54-33-28(44)24(40)26(42)29(53-33)31(45)46)34(52-19)50-14-7-15(35)20-16(36)9-17(51-18(20)8-14)12-3-5-13(47-2)6-4-12/h3-9,11,19,21-30,32-35,37-44H,10H2,1-2H3,(H,45,46)/t11-,19+,21-,22+,23+,24-,25-,26-,27+,28+,29-,30+,32+,33-,34+/m0/s1 |
InChI Key | HAHATWZTPFFMJI-NGUXHJNGSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C34H40O20 |
Molecular Weight | 768.70 g/mol |
Exact Mass | 768.21129366 g/mol |
Topological Polar Surface Area (TPSA) | 310.00 Ų |
XlogP | -1.80 |
HY-N12030 |
CS-0890708 |
![2D Structure of Acacetin 7-O-|A-D-glucuronopyranosyl-(1 inverted exclamation marku2)[|A-L-rhamnopyranosyl-(1 inverted exclamation marku6)]-|A-D-glucopyranoside 2D Structure of Acacetin 7-O-|A-D-glucuronopyranosyl-(1 inverted exclamation marku2)[|A-L-rhamnopyranosyl-(1 inverted exclamation marku6)]-|A-D-glucopyranoside](https://plantaedb.com/storage/docs/compounds/2023/11/4b5f3f20-85a0-11ee-b64a-1b2f0de48434.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.68% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.67% | 91.49% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.72% | 85.14% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.06% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.98% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 95.86% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.48% | 94.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 94.10% | 97.36% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.78% | 99.15% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.48% | 95.56% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 93.16% | 81.11% |
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 91.77% | 87.67% |
CHEMBL3194 | P02766 | Transthyretin | 90.91% | 90.71% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.31% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.13% | 94.73% |
CHEMBL1907 | P15144 | Aminopeptidase N | 88.04% | 93.31% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 85.93% | 86.92% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.71% | 96.09% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 83.74% | 91.71% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.52% | 90.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.10% | 95.50% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.74% | 95.89% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 81.69% | 83.57% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.74% | 96.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.64% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Robinia pseudoacacia |
PubChem | 101497870 |
LOTUS | LTS0217204 |
wikiData | Q105024881 |