(2R,3R,4S,5S,6R)-2-[[(1R,3R,8S,9S,10R,14S,16S,17R)-3-hydroxy-17-[(2S,3S)-3-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-16-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol
Internal ID | 7fb383dc-3524-492f-befe-52f55feb9513 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
IUPAC Name | (2R,3R,4S,5S,6R)-2-[[(1R,3R,8S,9S,10R,14S,16S,17R)-3-hydroxy-17-[(2S,3S)-3-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-16-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | CC(C)CCC(C(C)C1C(CC2C1(CCC3C2CC=C4C3(C(CC(C4)O)OC5C(C(C(C(O5)CO)O)O)O)C)C)OC6C(C(C(C(O6)CO)O)O)O)O |
SMILES (Isomeric) | C[C@@H]([C@H]1[C@H](C[C@@H]2C1(CC[C@H]3[C@H]2CC=C4[C@@]3([C@@H](C[C@@H](C4)O)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)C)C)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)[C@H](CCC(C)C)O |
InChI | InChI=1S/C39H66O14/c1-17(2)6-9-24(43)18(3)29-25(50-36-34(48)32(46)30(44)26(15-40)51-36)14-23-21-8-7-19-12-20(42)13-28(39(19,5)22(21)10-11-38(23,29)4)53-37-35(49)33(47)31(45)27(16-41)52-37/h7,17-18,20-37,40-49H,6,8-16H2,1-5H3/t18-,20-,21-,22+,23+,24+,25+,26-,27-,28-,29+,30-,31-,32+,33+,34-,35-,36-,37+,38?,39+/m1/s1 |
InChI Key | JPJDIOVDAAVUNF-CKDXGSNZSA-N |
Popularity | 0 references in papers |
Molecular Formula | C39H66O14 |
Molecular Weight | 758.90 g/mol |
Exact Mass | 758.44525677 g/mol |
Topological Polar Surface Area (TPSA) | 239.00 Ų |
XlogP | 1.50 |
There are no found synonyms. |
![2D Structure of (2R,3R,4S,5S,6R)-2-[[(1R,3R,8S,9S,10R,14S,16S,17R)-3-hydroxy-17-[(2S,3S)-3-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-16-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol 2D Structure of (2R,3R,4S,5S,6R)-2-[[(1R,3R,8S,9S,10R,14S,16S,17R)-3-hydroxy-17-[(2S,3S)-3-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-16-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/4b141400-83c6-11ee-82cc-27829068bfc1.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.95% | 96.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 98.54% | 95.93% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.09% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.39% | 97.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.25% | 97.25% |
CHEMBL2581 | P07339 | Cathepsin D | 93.72% | 98.95% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 92.34% | 95.89% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.20% | 85.14% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.46% | 100.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 89.56% | 93.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.79% | 89.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 87.64% | 100.00% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 87.57% | 98.05% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.57% | 97.14% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 87.20% | 97.79% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.19% | 94.45% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.98% | 90.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.64% | 86.33% |
CHEMBL237 | P41145 | Kappa opioid receptor | 85.15% | 98.10% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.26% | 94.73% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.90% | 95.89% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 81.90% | 89.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ornithogalum candicans |
PubChem | 163185480 |
LOTUS | LTS0261184 |
wikiData | Q105132832 |