(4aS,5S,8aR)-8-methyl-3-methylidene-5-propan-2-yl-2,4,4a,5,6,8a-hexahydro-1H-naphthalene
| Internal ID | 7e271738-c9d6-4bb8-a2fe-267b374a4ba5 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | (4aS,5S,8aR)-8-methyl-3-methylidene-5-propan-2-yl-2,4,4a,5,6,8a-hexahydro-1H-naphthalene |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C15H24/c1-10(2)13-8-6-12(4)14-7-5-11(3)9-15(13)14/h6,10,13-15H,3,5,7-9H2,1-2,4H3/t13-,14-,15-/m0/s1 |
| InChI Key | COEMCKKNQLRLNH-KKUMJFAQSA-N |
| Popularity | 5 references in papers |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.35 g/mol |
| Exact Mass | 204.187800766 g/mol |
| Topological Polar Surface Area (TPSA) | 0.00 Ų |
| XlogP | 4.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 91.62% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.25% | 96.09% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.46% | 93.56% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 84.18% | 86.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.99% | 95.89% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.93% | 90.71% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.73% | 97.09% |
| CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 83.51% | 90.71% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.27% | 100.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.17% | 91.11% |
| CHEMBL1871 | P10275 | Androgen Receptor | 82.68% | 96.43% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.02% | 95.56% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 80.79% | 90.24% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 80.54% | 90.08% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Lindera aggregata |
| Thapsia villosa |
| Thujopsis dolabrata |
| PubChem | 12358779 |
| LOTUS | LTS0193859 |
| wikiData | Q104966807 |