(2S,3S,3aS,4S,5aR,5bR,7aR,9S,11aR,11bR,13aR,13bR)-9-[(2S,3R,4S,5R)-4,5-dihydroxy-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-2,4-dihydroxy-3-(2-hydroxypropan-2-yl)-5a,5b,8,8,11a,13b-hexamethyl-2,3,3a,4,5,6,7a,9,10,11,11b,12,13,13a-tetradecahydro-1H-cyclopenta[a]chrysen-7-one
| Internal ID | 253f85b5-2fda-491c-8571-6161cf22c0ad |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Hopanoids |
| IUPAC Name | (2S,3S,3aS,4S,5aR,5bR,7aR,9S,11aR,11bR,13aR,13bR)-9-[(2S,3R,4S,5R)-4,5-dihydroxy-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-2,4-dihydroxy-3-(2-hydroxypropan-2-yl)-5a,5b,8,8,11a,13b-hexamethyl-2,3,3a,4,5,6,7a,9,10,11,11b,12,13,13a-tetradecahydro-1H-cyclopenta[a]chrysen-7-one |
| SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(COC2OC3CCC4(C5CCC6C7(CC(C(C7C(CC6(C5(CC(=O)C4C3(C)C)C)C)O)C(C)(C)O)O)C)C)O)O)O)O)O |
| SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@@H](CO[C@H]2O[C@H]3CC[C@@]4([C@H]5CC[C@@H]6[C@]7(C[C@@H]([C@H]([C@@H]7[C@H](C[C@]6([C@@]5(CC(=O)[C@H]4C3(C)C)C)C)O)C(C)(C)O)O)C)C)O)O)O)O)O |
| InChI | InChI=1S/C41H68O13/c1-18-28(46)30(48)31(49)34(52-18)54-32-29(47)22(45)17-51-35(32)53-25-12-13-38(6)23-10-11-24-39(7)14-19(42)26(37(4,5)50)27(39)20(43)15-40(24,8)41(23,9)16-21(44)33(38)36(25,2)3/h18-20,22-35,42-43,45-50H,10-17H2,1-9H3/t18-,19-,20-,22+,23+,24+,25-,26+,27-,28-,29-,30+,31+,32+,33-,34-,35-,38+,39+,40+,41+/m0/s1 |
| InChI Key | PMIQHWRFLIHWFG-KVKVNFHYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C41H68O13 |
| Molecular Weight | 769.00 g/mol |
| Exact Mass | 768.46599222 g/mol |
| Topological Polar Surface Area (TPSA) | 216.00 Ų |
| XlogP | 2.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 97.69% | 96.77% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.64% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.96% | 97.25% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.78% | 98.95% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 92.33% | 97.36% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 92.00% | 92.94% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.25% | 89.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.44% | 95.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.15% | 94.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 89.78% | 97.14% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.38% | 86.33% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 88.90% | 85.31% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 88.25% | 91.49% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.90% | 95.89% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 86.87% | 95.92% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.80% | 96.09% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 86.56% | 92.88% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.10% | 97.09% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 86.03% | 94.78% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.22% | 100.00% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 85.01% | 96.61% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.79% | 94.75% |
| CHEMBL1871 | P10275 | Androgen Receptor | 84.58% | 96.43% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 83.93% | 95.71% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 83.12% | 97.33% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.44% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Glinus lotoides |
| PubChem | 162978614 |
| LOTUS | LTS0080530 |
| wikiData | Q105211489 |