4,9-Dimethoxy-14-oxa-7-azatetracyclo[6.6.1.01,11.02,7]pentadec-11-en-13-one
Internal ID | 5f5ed7cd-2a3a-42c1-a166-6d7a13008a26 |
Taxonomy | Organoheterocyclic compounds > Indolizidines |
IUPAC Name | 4,9-dimethoxy-14-oxa-7-azatetracyclo[6.6.1.01,11.02,7]pentadec-11-en-13-one |
SMILES (Canonical) | COC1CCN2C(C1)C34CC2C(CC3=CC(=O)O4)OC |
SMILES (Isomeric) | COC1CCN2C(C1)C34CC2C(CC3=CC(=O)O4)OC |
InChI | InChI=1S/C15H21NO4/c1-18-10-3-4-16-11-8-15(13(16)7-10)9(5-12(11)19-2)6-14(17)20-15/h6,10-13H,3-5,7-8H2,1-2H3 |
InChI Key | KBEIBRVSMQBGPK-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H21NO4 |
Molecular Weight | 279.33 g/mol |
Exact Mass | 279.14705815 g/mol |
Topological Polar Surface Area (TPSA) | 48.00 Ų |
XlogP | 0.30 |
There are no found synonyms. |
![2D Structure of 4,9-Dimethoxy-14-oxa-7-azatetracyclo[6.6.1.01,11.02,7]pentadec-11-en-13-one 2D Structure of 4,9-Dimethoxy-14-oxa-7-azatetracyclo[6.6.1.01,11.02,7]pentadec-11-en-13-one](https://plantaedb.com/storage/docs/compounds/2023/11/49-dimethoxy-14-oxa-7-azatetracyclo6610111027pentadec-11-en-13-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.96% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 92.65% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.24% | 85.14% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.15% | 91.11% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 90.92% | 93.40% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.88% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.24% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.71% | 94.45% |
CHEMBL1871 | P10275 | Androgen Receptor | 87.66% | 96.43% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.30% | 95.89% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.15% | 97.14% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.70% | 92.94% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.52% | 97.25% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.96% | 99.23% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.35% | 94.00% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 82.14% | 97.05% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 82.08% | 93.04% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.69% | 100.00% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 81.02% | 97.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Flueggea suffruticosa |
PubChem | 162851663 |
LOTUS | LTS0059982 |
wikiData | Q105138138 |