[18,19-Dihydroxy-5',7,9,13-tetramethyl-15-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl] 2-hydroxybutanoate
Internal ID | b808ad0d-9d9a-479b-a520-eeb64ace6e71 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | [18,19-dihydroxy-5',7,9,13-tetramethyl-15-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl] 2-hydroxybutanoate |
SMILES (Canonical) | CCC(C(=O)OC1CC2(C(CC3C(C2(CC1OC4C(C(C(C(O4)CO)O)O)O)C)CCC5(C3CC6C5C(C7(O6)CCC(CO7)C)C)C)O)O)O |
SMILES (Isomeric) | CCC(C(=O)OC1CC2(C(CC3C(C2(CC1OC4C(C(C(C(O4)CO)O)O)O)C)CCC5(C3CC6C5C(C7(O6)CCC(CO7)C)C)C)O)O)O |
InChI | InChI=1S/C37H60O13/c1-6-22(39)32(44)47-25-14-36(45)27(40)11-19-20(35(36,5)13-24(25)48-33-31(43)30(42)29(41)26(15-38)49-33)8-9-34(4)21(19)12-23-28(34)18(3)37(50-23)10-7-17(2)16-46-37/h17-31,33,38-43,45H,6-16H2,1-5H3 |
InChI Key | SQOIMYLIMNRUHZ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C37H60O13 |
Molecular Weight | 712.90 g/mol |
Exact Mass | 712.40339196 g/mol |
Topological Polar Surface Area (TPSA) | 205.00 Ų |
XlogP | 2.40 |
Atomic LogP (AlogP) | 1.00 |
H-Bond Acceptor | 13 |
H-Bond Donor | 7 |
Rotatable Bonds | 6 |
There are no found synonyms. |
![2D Structure of [18,19-Dihydroxy-5',7,9,13-tetramethyl-15-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl] 2-hydroxybutanoate 2D Structure of [18,19-Dihydroxy-5',7,9,13-tetramethyl-15-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl] 2-hydroxybutanoate](https://plantaedb.com/storage/docs/compounds/2023/11/4855f4c0-8580-11ee-aee8-57e7a395b536.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.7212 | 72.12% |
Caco-2 | - | 0.8778 | 87.78% |
Blood Brain Barrier | - | 0.6750 | 67.50% |
Human oral bioavailability | - | 0.8286 | 82.86% |
Subcellular localzation | Mitochondria | 0.6765 | 67.65% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.8623 | 86.23% |
OATP1B3 inhibitior | + | 0.9339 | 93.39% |
MATE1 inhibitior | - | 1.0000 | 100.00% |
OCT2 inhibitior | - | 0.5250 | 52.50% |
BSEP inhibitior | - | 0.5914 | 59.14% |
P-glycoprotein inhibitior | + | 0.7128 | 71.28% |
P-glycoprotein substrate | - | 0.5124 | 51.24% |
CYP3A4 substrate | + | 0.7542 | 75.42% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.8755 | 87.55% |
CYP3A4 inhibition | - | 0.8442 | 84.42% |
CYP2C9 inhibition | - | 0.9049 | 90.49% |
CYP2C19 inhibition | - | 0.8803 | 88.03% |
CYP2D6 inhibition | - | 0.9518 | 95.18% |
CYP1A2 inhibition | - | 0.9185 | 91.85% |
CYP2C8 inhibition | + | 0.7487 | 74.87% |
CYP inhibitory promiscuity | - | 0.9490 | 94.90% |
UGT catelyzed | + | 0.9000 | 90.00% |
Carcinogenicity (binary) | - | 1.0000 | 100.00% |
Carcinogenicity (trinary) | Non-required | 0.6398 | 63.98% |
Eye corrosion | - | 0.9923 | 99.23% |
Eye irritation | - | 0.9216 | 92.16% |
Skin irritation | - | 0.6019 | 60.19% |
Skin corrosion | - | 0.9468 | 94.68% |
Ames mutagenesis | - | 0.6437 | 64.37% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.6521 | 65.21% |
Micronuclear | - | 0.8800 | 88.00% |
Hepatotoxicity | - | 0.7854 | 78.54% |
skin sensitisation | - | 0.9390 | 93.90% |
Respiratory toxicity | + | 0.7333 | 73.33% |
Reproductive toxicity | + | 0.7333 | 73.33% |
Mitochondrial toxicity | + | 0.5375 | 53.75% |
Nephrotoxicity | - | 0.7918 | 79.18% |
Acute Oral Toxicity (c) | I | 0.5298 | 52.98% |
Estrogen receptor binding | + | 0.7025 | 70.25% |
Androgen receptor binding | + | 0.7467 | 74.67% |
Thyroid receptor binding | - | 0.6788 | 67.88% |
Glucocorticoid receptor binding | + | 0.5954 | 59.54% |
Aromatase binding | + | 0.6487 | 64.87% |
PPAR gamma | + | 0.6475 | 64.75% |
Honey bee toxicity | - | 0.5590 | 55.90% |
Biodegradation | - | 0.6750 | 67.50% |
Crustacea aquatic toxicity | - | 0.6200 | 62.00% |
Fish aquatic toxicity | + | 0.8730 | 87.30% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.76% | 96.09% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 98.34% | 96.61% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.98% | 97.25% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 97.06% | 97.09% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 96.76% | 89.05% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.50% | 94.45% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 95.40% | 92.86% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.44% | 91.11% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.19% | 90.17% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 93.85% | 92.50% |
CHEMBL204 | P00734 | Thrombin | 93.66% | 96.01% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 93.59% | 96.21% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 93.44% | 98.75% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.90% | 100.00% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 90.82% | 91.24% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 90.58% | 95.50% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 89.57% | 96.77% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 89.56% | 96.95% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.51% | 91.19% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.11% | 85.14% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 87.89% | 86.92% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.97% | 100.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 85.87% | 95.93% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 85.77% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.72% | 89.00% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 85.69% | 82.50% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 85.47% | 97.50% |
CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 85.10% | 99.17% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.05% | 95.89% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 84.19% | 94.00% |
CHEMBL237 | P41145 | Kappa opioid receptor | 83.73% | 98.10% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 83.52% | 97.31% |
CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 82.96% | 96.33% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.53% | 92.62% |
CHEMBL2360 | P00492 | Hypoxanthine-guanine phosphoribosyltransferase | 82.42% | 87.38% |
CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 82.24% | 92.32% |
CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 82.18% | 99.00% |
CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 82.12% | 92.78% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 81.94% | 100.00% |
CHEMBL2581 | P07339 | Cathepsin D | 81.59% | 98.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.46% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.28% | 86.33% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 81.21% | 100.00% |
CHEMBL5028 | O14672 | ADAM10 | 81.15% | 97.50% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.98% | 93.56% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 80.92% | 96.90% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 80.66% | 96.47% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 80.50% | 96.37% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 80.49% | 97.28% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Allium karataviense |
PubChem | 85262633 |
LOTUS | LTS0138506 |
wikiData | Q105258283 |