[18,19-Dihydroxy-5',7,9,13-tetramethyl-15-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl] 2-hydroxybutanoate
Internal ID | b808ad0d-9d9a-479b-a520-eeb64ace6e71 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | [18,19-dihydroxy-5',7,9,13-tetramethyl-15-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl] 2-hydroxybutanoate |
SMILES (Canonical) | CCC(C(=O)OC1CC2(C(CC3C(C2(CC1OC4C(C(C(C(O4)CO)O)O)O)C)CCC5(C3CC6C5C(C7(O6)CCC(CO7)C)C)C)O)O)O |
SMILES (Isomeric) | CCC(C(=O)OC1CC2(C(CC3C(C2(CC1OC4C(C(C(C(O4)CO)O)O)O)C)CCC5(C3CC6C5C(C7(O6)CCC(CO7)C)C)C)O)O)O |
InChI | InChI=1S/C37H60O13/c1-6-22(39)32(44)47-25-14-36(45)27(40)11-19-20(35(36,5)13-24(25)48-33-31(43)30(42)29(41)26(15-38)49-33)8-9-34(4)21(19)12-23-28(34)18(3)37(50-23)10-7-17(2)16-46-37/h17-31,33,38-43,45H,6-16H2,1-5H3 |
InChI Key | SQOIMYLIMNRUHZ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C37H60O13 |
Molecular Weight | 712.90 g/mol |
Exact Mass | 712.40339196 g/mol |
Topological Polar Surface Area (TPSA) | 205.00 Ų |
XlogP | 2.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.76% | 96.09% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 98.34% | 96.61% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.98% | 97.25% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 97.06% | 97.09% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 96.76% | 89.05% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.50% | 94.45% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 95.40% | 92.86% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.44% | 91.11% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.19% | 90.17% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 93.85% | 92.50% |
CHEMBL204 | P00734 | Thrombin | 93.66% | 96.01% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 93.59% | 96.21% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 93.44% | 98.75% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.90% | 100.00% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 90.82% | 91.24% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 90.58% | 95.50% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 89.57% | 96.77% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 89.56% | 96.95% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.51% | 91.19% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.11% | 85.14% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 87.89% | 86.92% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.97% | 100.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 85.87% | 95.93% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 85.77% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.72% | 89.00% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 85.69% | 82.50% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 85.47% | 97.50% |
CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 85.10% | 99.17% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.05% | 95.89% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 84.19% | 94.00% |
CHEMBL237 | P41145 | Kappa opioid receptor | 83.73% | 98.10% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 83.52% | 97.31% |
CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 82.96% | 96.33% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.53% | 92.62% |
CHEMBL2360 | P00492 | Hypoxanthine-guanine phosphoribosyltransferase | 82.42% | 87.38% |
CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 82.24% | 92.32% |
CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 82.18% | 99.00% |
CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 82.12% | 92.78% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 81.94% | 100.00% |
CHEMBL2581 | P07339 | Cathepsin D | 81.59% | 98.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.46% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.28% | 86.33% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 81.21% | 100.00% |
CHEMBL5028 | O14672 | ADAM10 | 81.15% | 97.50% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.98% | 93.56% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 80.92% | 96.90% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 80.66% | 96.47% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 80.50% | 96.37% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 80.49% | 97.28% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Allium karataviense |
PubChem | 85262633 |
LOTUS | LTS0138506 |
wikiData | Q105258283 |