[(1S,19R,21S,22R,23S)-6,7,8,11,12,13,22,23-octahydroxy-3,16-dioxo-2,17,20-trioxatetracyclo[17.3.1.04,9.010,15]tricosa-4,6,8,10,12,14-hexaen-21-yl] 3,4,5-trihydroxybenzoate
Internal ID | dd51537d-ef8a-4b3b-877e-e61bb4b9bb3f |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | [(1S,19R,21S,22R,23S)-6,7,8,11,12,13,22,23-octahydroxy-3,16-dioxo-2,17,20-trioxatetracyclo[17.3.1.04,9.010,15]tricosa-4,6,8,10,12,14-hexaen-21-yl] 3,4,5-trihydroxybenzoate |
SMILES (Canonical) | C1C2C(C(C(C(O2)OC(=O)C3=CC(=C(C(=C3)O)O)O)O)OC(=O)C4=CC(=C(C(=C4C5=C(C(=C(C=C5C(=O)O1)O)O)O)O)O)O)O |
SMILES (Isomeric) | C1[C@@H]2[C@@H]([C@@H]([C@H]([C@@H](O2)OC(=O)C3=CC(=C(C(=C3)O)O)O)O)OC(=O)C4=CC(=C(C(=C4C5=C(C(=C(C=C5C(=O)O1)O)O)O)O)O)O)O |
InChI | InChI=1S/C27H22O18/c28-9-1-6(2-10(29)16(9)32)24(39)45-27-22(38)23-19(35)13(43-27)5-42-25(40)7-3-11(30)17(33)20(36)14(7)15-8(26(41)44-23)4-12(31)18(34)21(15)37/h1-4,13,19,22-23,27-38H,5H2/t13-,19+,22-,23+,27+/m1/s1 |
InChI Key | TUSDEZXZIZRFGC-VWUIOQLHSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H22O18 |
Molecular Weight | 634.50 g/mol |
Exact Mass | 634.08061385 g/mol |
Topological Polar Surface Area (TPSA) | 311.00 Ų |
XlogP | 0.10 |
There are no found synonyms. |
![2D Structure of [(1S,19R,21S,22R,23S)-6,7,8,11,12,13,22,23-octahydroxy-3,16-dioxo-2,17,20-trioxatetracyclo[17.3.1.04,9.010,15]tricosa-4,6,8,10,12,14-hexaen-21-yl] 3,4,5-trihydroxybenzoate 2D Structure of [(1S,19R,21S,22R,23S)-6,7,8,11,12,13,22,23-octahydroxy-3,16-dioxo-2,17,20-trioxatetracyclo[17.3.1.04,9.010,15]tricosa-4,6,8,10,12,14-hexaen-21-yl] 3,4,5-trihydroxybenzoate](https://plantaedb.com/storage/docs/compounds/2023/11/4852fe60-854b-11ee-bc7d-b5d3bfa72a9c.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL2392 | P06746 | DNA polymerase beta |
158.5 nM |
Potency |
via Super-PRED
|
CHEMBL2362978 | P43351 | DNA repair protein RAD52 homolog |
500 nM |
IC50 |
via Super-PRED
|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase |
50.1 nM |
Potency |
via Super-PRED
|
CHEMBL1287622 | Q9Y468 | Lethal(3)malignant brain tumor-like protein 1 |
100 nM |
Potency |
via Super-PRED
|
CHEMBL2095202 | P63316 | Troponin, cardiac muscle |
676.76 nM |
IC50 |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.51% | 89.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 91.61% | 91.49% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 90.78% | 83.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.25% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 88.40% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.42% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.09% | 95.56% |
CHEMBL3194 | P02766 | Transthyretin | 86.49% | 90.71% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.74% | 95.89% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.49% | 99.17% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.25% | 99.23% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 83.78% | 96.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.45% | 94.73% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.55% | 90.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.05% | 99.15% |
CHEMBL2535 | P11166 | Glucose transporter | 80.93% | 98.75% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 80.32% | 95.64% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.25% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.25% | 100.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.20% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cunonia macrophylla |
Geranium pusillum |
Geranium thunbergii |
Pelargonium reniforme |
Phyllanthus emblica |
Punica granatum |
PubChem | 154496377 |
LOTUS | LTS0205222 |
wikiData | Q105265005 |