[3-[3,4-Dihydroxy-6-(hydroxymethyl)-5-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxy-17-ethyl-5,6-dihydroxy-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-16-yl] 4-methyl-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentanoate
Internal ID | 364408c7-8580-4837-8e54-fde819ecb0a4 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | [3-[3,4-dihydroxy-6-(hydroxymethyl)-5-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxy-17-ethyl-5,6-dihydroxy-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-16-yl] 4-methyl-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentanoate |
SMILES (Canonical) | CCC1C(CC2C1(CCC3C2CC(C4(C3(CCC(C4)OC5C(C(C(C(O5)CO)OC6C(C(C(C(O6)C)O)O)O)O)O)C)O)O)C)OC(=O)CCC(C)COC7C(C(C(C(O7)CO)O)O)O |
SMILES (Isomeric) | CCC1C(CC2C1(CCC3C2CC(C4(C3(CCC(C4)OC5C(C(C(C(O5)CO)OC6C(C(C(C(O6)C)O)O)O)O)O)C)O)O)C)OC(=O)CCC(C)COC7C(C(C(C(O7)CO)O)O)O |
InChI | InChI=1S/C45H76O20/c1-6-23-26(62-30(49)8-7-19(2)18-59-40-36(55)34(53)32(51)27(16-46)63-40)14-25-22-13-29(48)45(58)15-21(9-12-44(45,5)24(22)10-11-43(23,25)4)61-42-38(57)35(54)39(28(17-47)64-42)65-41-37(56)33(52)31(50)20(3)60-41/h19-29,31-42,46-48,50-58H,6-18H2,1-5H3 |
InChI Key | SXROYBYQKBRRSB-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C45H76O20 |
Molecular Weight | 937.10 g/mol |
Exact Mass | 936.49299481 g/mol |
Topological Polar Surface Area (TPSA) | 324.00 Ų |
XlogP | -1.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.09% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.24% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.38% | 91.11% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 96.58% | 96.21% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 95.95% | 96.61% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 95.15% | 97.64% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.07% | 97.09% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 92.88% | 92.98% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 92.72% | 95.71% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 92.64% | 95.93% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 91.52% | 92.50% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 91.26% | 89.05% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 90.71% | 97.29% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.67% | 100.00% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 90.44% | 96.47% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 89.99% | 100.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.64% | 94.45% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 88.96% | 98.46% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 88.88% | 96.38% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 88.43% | 94.23% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.54% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 85.66% | 98.95% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 85.46% | 95.50% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 84.44% | 98.05% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 84.20% | 97.50% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.94% | 95.89% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 83.85% | 92.86% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.84% | 93.56% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 83.62% | 82.50% |
CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 83.31% | 99.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.11% | 91.19% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 83.10% | 89.50% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.09% | 100.00% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 82.51% | 96.90% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 81.58% | 90.17% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.14% | 94.33% |
CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 80.92% | 95.36% |
CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 80.69% | 92.78% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.41% | 95.89% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 80.39% | 97.86% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Allium tuberosum |
PubChem | 72978075 |
LOTUS | LTS0228138 |
wikiData | Q105263292 |