[18,19-Dihydroxy-6-methoxy-7,9,13-trimethyl-6-[3-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-15-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-16-yl] acetate
| Internal ID | 9b24dd19-bf99-432d-a4f4-125c53edcab7 |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
| IUPAC Name | [18,19-dihydroxy-6-methoxy-7,9,13-trimethyl-6-[3-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-15-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-16-yl] acetate |
| SMILES (Canonical) | CC1C2C(CC3C2(CCC4C3CC(C5(C4(CC(C(C5)OC(=O)C)OC6C(C(C(C(O6)CO)O)O)O)C)O)O)C)OC1(CCC(C)COC7C(C(C(C(O7)CO)O)O)O)OC |
| SMILES (Isomeric) | CC1C2C(CC3C2(CCC4C3CC(C5(C4(CC(C(C5)OC(=O)C)OC6C(C(C(C(O6)CO)O)O)O)C)O)O)C)OC1(CCC(C)COC7C(C(C(C(O7)CO)O)O)O)OC |
| InChI | InChI=1S/C42H70O18/c1-18(17-55-37-35(51)33(49)31(47)27(15-43)58-37)7-10-42(54-6)19(2)30-24(60-42)12-23-21-11-29(46)41(53)14-26(56-20(3)45)25(13-40(41,5)22(21)8-9-39(23,30)4)57-38-36(52)34(50)32(48)28(16-44)59-38/h18-19,21-38,43-44,46-53H,7-17H2,1-6H3 |
| InChI Key | KRLJDRDCQFSWDY-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C42H70O18 |
| Molecular Weight | 863.00 g/mol |
| Exact Mass | 862.45621538 g/mol |
| Topological Polar Surface Area (TPSA) | 284.00 Ų |
| XlogP | 0.00 |
| Atomic LogP (AlogP) | -1.32 |
| H-Bond Acceptor | 18 |
| H-Bond Donor | 10 |
| Rotatable Bonds | 12 |
| There are no found synonyms. |
![2D Structure of [18,19-Dihydroxy-6-methoxy-7,9,13-trimethyl-6-[3-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-15-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-16-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/47153940-7f8a-11ee-b8cd-5f0739406822.jpg "2D Structure of [18,19-Dihydroxy-6-methoxy-7,9,13-trimethyl-6-[3-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-15-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-16-yl] acetate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.5487 | 54.87% |
| Caco-2 | - | 0.8896 | 88.96% |
| Blood Brain Barrier | - | 0.7000 | 70.00% |
| Human oral bioavailability | - | 0.7571 | 75.71% |
| Subcellular localzation | Mitochondria | 0.6988 | 69.88% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8641 | 86.41% |
| OATP1B3 inhibitior | + | 0.9420 | 94.20% |
| MATE1 inhibitior | - | 1.0000 | 100.00% |
| OCT2 inhibitior | - | 0.6000 | 60.00% |
| BSEP inhibitior | + | 0.6011 | 60.11% |
| P-glycoprotein inhibitior | + | 0.7514 | 75.14% |
| P-glycoprotein substrate | + | 0.5919 | 59.19% |
| CYP3A4 substrate | + | 0.7566 | 75.66% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8867 | 88.67% |
| CYP3A4 inhibition | - | 0.9414 | 94.14% |
| CYP2C9 inhibition | - | 0.9172 | 91.72% |
| CYP2C19 inhibition | - | 0.9094 | 90.94% |
| CYP2D6 inhibition | - | 0.9567 | 95.67% |
| CYP1A2 inhibition | - | 0.9299 | 92.99% |
| CYP2C8 inhibition | + | 0.6857 | 68.57% |
| CYP inhibitory promiscuity | - | 0.9728 | 97.28% |
| UGT catelyzed | + | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 1.0000 | 100.00% |
| Carcinogenicity (trinary) | Non-required | 0.6381 | 63.81% |
| Eye corrosion | - | 0.9914 | 99.14% |
| Eye irritation | - | 0.9102 | 91.02% |
| Skin irritation | - | 0.6564 | 65.64% |
| Skin corrosion | - | 0.9487 | 94.87% |
| Ames mutagenesis | - | 0.6615 | 66.15% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7367 | 73.67% |
| Micronuclear | - | 0.9000 | 90.00% |
| Hepatotoxicity | - | 0.6988 | 69.88% |
| skin sensitisation | - | 0.9361 | 93.61% |
| Respiratory toxicity | + | 0.6444 | 64.44% |
| Reproductive toxicity | + | 0.7556 | 75.56% |
| Mitochondrial toxicity | + | 0.5125 | 51.25% |
| Nephrotoxicity | - | 0.7343 | 73.43% |
| Acute Oral Toxicity (c) | I | 0.6342 | 63.42% |
| Estrogen receptor binding | + | 0.7884 | 78.84% |
| Androgen receptor binding | + | 0.7428 | 74.28% |
| Thyroid receptor binding | - | 0.6128 | 61.28% |
| Glucocorticoid receptor binding | + | 0.6297 | 62.97% |
| Aromatase binding | + | 0.6506 | 65.06% |
| PPAR gamma | + | 0.7535 | 75.35% |
| Honey bee toxicity | - | 0.5761 | 57.61% |
| Biodegradation | - | 0.7750 | 77.50% |
| Crustacea aquatic toxicity | - | 0.6755 | 67.55% |
| Fish aquatic toxicity | + | 0.6978 | 69.78% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.16% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.73% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.10% | 94.45% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 95.79% | 96.61% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.75% | 85.14% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 93.87% | 89.05% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.83% | 97.09% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 93.10% | 96.21% |
| CHEMBL204 | P00734 | Thrombin | 92.19% | 96.01% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.78% | 97.25% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.60% | 100.00% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 90.53% | 92.86% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.11% | 95.89% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 88.99% | 94.08% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 88.87% | 91.24% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 88.56% | 96.47% |
| CHEMBL203 | P00533 | Epidermal growth factor receptor erbB1 | 88.01% | 97.34% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 87.15% | 92.50% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 86.57% | 98.10% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.48% | 91.19% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 86.18% | 95.71% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 86.12% | 92.98% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 86.02% | 89.50% |
| CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 85.93% | 95.36% |
| CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 85.91% | 82.50% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 84.64% | 100.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 84.50% | 100.00% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 84.46% | 98.75% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 84.35% | 95.93% |
| CHEMBL2581 | P07339 | Cathepsin D | 83.72% | 98.95% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.22% | 97.14% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 82.51% | 95.50% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.12% | 95.89% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.03% | 89.00% |
| CHEMBL5028 | O14672 | ADAM10 | 81.99% | 97.50% |
| CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 81.61% | 99.17% |
| CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 80.98% | 99.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.53% | 86.33% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.49% | 90.17% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.46% | 94.33% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 80.19% | 93.18% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 80.01% | 92.88% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 80.01% | 96.77% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Allium giganteum |
| PubChem | 85106021 |
| LOTUS | LTS0046679 |
| wikiData | Q105145107 |