4,7-Dimethoxy-9,10-dihydrophenanthrene-1,2,5-triol
| Internal ID | 766d5e4b-b172-4373-adb8-e940aef08153 |
| Taxonomy | Benzenoids > Phenanthrenes and derivatives > Hydrophenanthrenes |
| IUPAC Name | 4,7-dimethoxy-9,10-dihydrophenanthrene-1,2,5-triol |
| SMILES (Canonical) | COC1=CC2=C(C(=C1)O)C3=C(C=C(C(=C3CC2)O)O)OC |
| SMILES (Isomeric) | COC1=CC2=C(C(=C1)O)C3=C(C=C(C(=C3CC2)O)O)OC |
| InChI | InChI=1S/C16H16O5/c1-20-9-5-8-3-4-10-15(14(8)11(17)6-9)13(21-2)7-12(18)16(10)19/h5-7,17-19H,3-4H2,1-2H3 |
| InChI Key | YCSHIEQXVSJONE-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.09977361 g/mol |
| Topological Polar Surface Area (TPSA) | 79.20 Ų |
| XlogP | 2.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.02% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.37% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.96% | 95.56% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 90.75% | 92.68% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.15% | 94.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.10% | 99.17% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 88.83% | 91.79% |
| CHEMBL2535 | P11166 | Glucose transporter | 88.11% | 98.75% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.54% | 94.45% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.48% | 90.00% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 87.37% | 91.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.26% | 92.94% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.57% | 99.15% |
| CHEMBL2002 | P12268 | Inosine-5'-monophosphate dehydrogenase 2 | 83.83% | 98.21% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.37% | 86.33% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 81.68% | 93.18% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 81.19% | 93.40% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.32% | 95.89% |
| CHEMBL2964 | P36507 | Dual specificity mitogen-activated protein kinase kinase 2 | 80.18% | 80.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Cannabis sativa |
| PubChem | 162975796 |
| LOTUS | LTS0220086 |
| wikiData | Q105346459 |