4,6-dimethoxy-5-[(E)-3-methoxy-3-methylbut-1-enyl]furo[2,3-b]quinoline
| Internal ID | d5a59c3f-4086-4b20-9d1d-40dc290ed308 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Furanoquinolines |
| IUPAC Name | 4,6-dimethoxy-5-[(E)-3-methoxy-3-methylbut-1-enyl]furo[2,3-b]quinoline |
| SMILES (Canonical) | CC(C)(C=CC1=C(C=CC2=C1C(=C3C=COC3=N2)OC)OC)OC |
| SMILES (Isomeric) | CC(C)(/C=C/C1=C(C=CC2=C1C(=C3C=COC3=N2)OC)OC)OC |
| InChI | InChI=1S/C19H21NO4/c1-19(2,23-5)10-8-12-15(21-3)7-6-14-16(12)17(22-4)13-9-11-24-18(13)20-14/h6-11H,1-5H3/b10-8+ |
| InChI Key | UXFOFGRXTPFDNH-CSKARUKUSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.14705815 g/mol |
| Topological Polar Surface Area (TPSA) | 53.70 Ų |
| XlogP | 3.80 |
| There are no found synonyms. |
![2D Structure of 4,6-dimethoxy-5-[(E)-3-methoxy-3-methylbut-1-enyl]furo[2,3-b]quinoline](https://plantaedb.com/storage/docs/compounds/2023/11/46-dimethoxy-5-e-3-methoxy-3-methylbut-1-enylfuro23-bquinoline.jpg "2D Structure of 4,6-dimethoxy-5-[(E)-3-methoxy-3-methylbut-1-enyl]furo[2,3-b]quinoline")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5747 | Q92793 | CREB-binding protein | 96.67% | 95.12% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 96.60% | 96.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.23% | 94.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.64% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.56% | 86.33% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.12% | 94.73% |
| CHEMBL1907599 | P05556 | Integrin alpha-4/beta-1 | 87.07% | 92.86% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.89% | 94.45% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 85.63% | 89.62% |
| CHEMBL4829 | O00763 | Acetyl-CoA carboxylase 2 | 85.24% | 98.00% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 85.08% | 100.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.31% | 85.14% |
| CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 84.15% | 92.38% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 83.37% | 96.90% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 83.29% | 94.03% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.97% | 99.23% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.47% | 89.00% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 82.33% | 93.65% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 81.60% | 91.49% |
| CHEMBL5014 | O43353 | Serine/threonine-protein kinase RIPK2 | 81.52% | 86.79% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.28% | 94.75% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 80.10% | 91.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Choisya ternata |
| PubChem | 23628505 |
| LOTUS | LTS0110751 |
| wikiData | Q105280752 |