5-hydroxy-2-(4-hydroxyphenyl)-8-(3-methylbut-2-enyl)-7-[(2S,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-[(2S,3S,5R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one
Internal ID | 91d874ef-bd63-4b05-9dc6-6b737b83756f |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 5-hydroxy-2-(4-hydroxyphenyl)-8-(3-methylbut-2-enyl)-7-[(2S,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-[(2S,3S,5R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2=C(OC3=C(C2=O)C(=CC(=C3CC=C(C)C)OC4C(C(C(C(O4)CO)O)O)O)O)C5=CC=C(C=C5)O)O)O)O |
SMILES (Isomeric) | CC1[C@@H](C([C@@H]([C@@H](O1)OC2=C(OC3=C(C2=O)C(=CC(=C3CC=C(C)C)O[C@H]4C([C@H]([C@@H](C(O4)CO)O)O)O)O)C5=CC=C(C=C5)O)O)O)O |
InChI | InChI=1S/C32H38O15/c1-12(2)4-9-16-18(44-32-27(42)25(40)22(37)19(11-33)45-32)10-17(35)20-23(38)30(47-31-26(41)24(39)21(36)13(3)43-31)28(46-29(16)20)14-5-7-15(34)8-6-14/h4-8,10,13,19,21-22,24-27,31-37,39-42H,9,11H2,1-3H3/t13?,19?,21-,22+,24?,25-,26-,27?,31-,32+/m0/s1 |
InChI Key | OGYXOOJUJQIDOX-IAILLBQISA-N |
Popularity | 5 references in papers |
Molecular Formula | C32H38O15 |
Molecular Weight | 662.60 g/mol |
Exact Mass | 662.22107050 g/mol |
Topological Polar Surface Area (TPSA) | 245.00 Ų |
XlogP | 1.30 |
There are no found synonyms. |
![2D Structure of 5-hydroxy-2-(4-hydroxyphenyl)-8-(3-methylbut-2-enyl)-7-[(2S,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-[(2S,3S,5R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one 2D Structure of 5-hydroxy-2-(4-hydroxyphenyl)-8-(3-methylbut-2-enyl)-7-[(2S,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-[(2S,3S,5R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/07/45fa3550-25ce-11ee-8e85-df5720296646.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.68% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 97.47% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.89% | 89.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 95.12% | 94.73% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.30% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.96% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.37% | 99.17% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 91.78% | 91.49% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.61% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.58% | 95.56% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.53% | 99.15% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 84.59% | 95.78% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 84.01% | 91.71% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 83.88% | 95.64% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 83.44% | 93.10% |
CHEMBL3194 | P02766 | Transthyretin | 83.38% | 90.71% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 82.62% | 86.92% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 82.53% | 85.14% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.01% | 96.00% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.96% | 94.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Epimedium acuminatum |
Epimedium brevicornu |
Epimedium diphyllum |
Epimedium sagittatum |
Epimedium sempervirens |
Epimedium wushanense |
Vancouveria hexandra |
PubChem | 44258788 |
NPASS | NPC118377 |
LOTUS | LTS0097022 |
wikiData | Q104393852 |