3,10-dihydroxy-9-[[(2S,3R)-6-hydroxy-2-(hydroxymethyl)-7-methoxy-2,3-dihydro-1-benzofuran-3-yl]oxy]benzo[c]chromen-6-one
| Internal ID | 6c517d5e-3bcf-4cd3-aea7-6955c974edee |
| Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives |
| IUPAC Name | 3,10-dihydroxy-9-[[(2S,3R)-6-hydroxy-2-(hydroxymethyl)-7-methoxy-2,3-dihydro-1-benzofuran-3-yl]oxy]benzo[c]chromen-6-one |
| SMILES (Canonical) | COC1=C(C=CC2=C1OC(C2OC3=C(C4=C(C=C3)C(=O)OC5=C4C=CC(=C5)O)O)CO)O |
| SMILES (Isomeric) | COC1=C(C=CC2=C1O[C@H]([C@@H]2OC3=C(C4=C(C=C3)C(=O)OC5=C4C=CC(=C5)O)O)CO)O |
| InChI | InChI=1S/C23H18O9/c1-29-22-14(26)6-4-13-20(17(9-24)31-21(13)22)30-15-7-5-12-18(19(15)27)11-3-2-10(25)8-16(11)32-23(12)28/h2-8,17,20,24-27H,9H2,1H3/t17-,20+/m0/s1 |
| InChI Key | PMSRLQCWGSYPEB-FXAWDEMLSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C23H18O9 |
| Molecular Weight | 438.40 g/mol |
| Exact Mass | 438.09508215 g/mol |
| Topological Polar Surface Area (TPSA) | 135.00 Ų |
| XlogP | 2.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.19% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.03% | 89.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.04% | 94.45% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.63% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.04% | 86.33% |
| CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 89.80% | 80.78% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.94% | 99.17% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.39% | 97.09% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.27% | 95.89% |
| CHEMBL3194 | P02766 | Transthyretin | 87.68% | 90.71% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.11% | 95.56% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 87.00% | 90.20% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.64% | 98.95% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.99% | 99.15% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 85.30% | 86.92% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.34% | 94.73% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 82.70% | 89.62% |
| CHEMBL3232685 | O00257 | E3 SUMO-protein ligase CBX4 | 81.87% | 93.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.70% | 99.23% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.04% | 91.19% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.92% | 96.09% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 80.75% | 98.11% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 80.07% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Vachellia karroo |
| PubChem | 163005285 |
| LOTUS | LTS0031249 |
| wikiData | Q105211716 |