[(3S,5R,6R,8R,9S,10R,13R,14S,15S,17R)-3,5,6-trihydroxy-10,13-dimethyl-17-[(2R,6S)-6-methyl-7-[(2R,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyheptan-2-yl]-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-15-yl] sulfate
Internal ID | 3e469f8c-7d53-4988-baad-6837bd05929e |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
IUPAC Name | [(3S,5R,6R,8R,9S,10R,13R,14S,15S,17R)-3,5,6-trihydroxy-10,13-dimethyl-17-[(2R,6S)-6-methyl-7-[(2R,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyheptan-2-yl]-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-15-yl] sulfate |
SMILES (Canonical) | CC(CCCC(C)C1CC(C2C1(CCC3C2CC(C4(C3(CCC(C4)O)C)O)O)C)OS(=O)(=O)[O-])COC5C(C(C(CO5)O)O)O |
SMILES (Isomeric) | C[C@@H](CCC[C@@H](C)[C@H]1C[C@@H]([C@@H]2[C@@]1(CC[C@H]3[C@H]2C[C@H]([C@@]4([C@@]3(CC[C@@H](C4)O)C)O)O)C)OS(=O)(=O)[O-])CO[C@H]5[C@@H]([C@H]([C@@H](CO5)O)O)O |
InChI | InChI=1S/C32H56O12S/c1-17(15-42-29-28(37)27(36)23(34)16-43-29)6-5-7-18(2)22-13-24(44-45(39,40)41)26-20-12-25(35)32(38)14-19(33)8-11-31(32,4)21(20)9-10-30(22,26)3/h17-29,33-38H,5-16H2,1-4H3,(H,39,40,41)/p-1/t17-,18+,19-,20+,21-,22+,23+,24-,25+,26+,27-,28+,29+,30+,31+,32-/m0/s1 |
InChI Key | YOZNQUBQEGDRRR-PGOVKOECSA-M |
Popularity | 0 references in papers |
Molecular Formula | C32H55O12S- |
Molecular Weight | 663.80 g/mol |
Exact Mass | 663.34142336 g/mol |
Topological Polar Surface Area (TPSA) | 215.00 Ų |
XlogP | 2.20 |
Atomic LogP (AlogP) | 1.45 |
H-Bond Acceptor | 12 |
H-Bond Donor | 6 |
Rotatable Bonds | 10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.5626 | 56.26% |
Caco-2 | - | 0.8648 | 86.48% |
Blood Brain Barrier | + | 0.5250 | 52.50% |
Human oral bioavailability | - | 0.5429 | 54.29% |
Subcellular localzation | Lysosomes | 0.4514 | 45.14% |
OATP2B1 inhibitior | - | 0.5773 | 57.73% |
OATP1B1 inhibitior | + | 0.8524 | 85.24% |
OATP1B3 inhibitior | + | 0.9278 | 92.78% |
MATE1 inhibitior | - | 0.9400 | 94.00% |
OCT2 inhibitior | - | 0.8000 | 80.00% |
BSEP inhibitior | - | 0.5380 | 53.80% |
P-glycoprotein inhibitior | + | 0.6905 | 69.05% |
P-glycoprotein substrate | + | 0.7164 | 71.64% |
CYP3A4 substrate | + | 0.7600 | 76.00% |
CYP2C9 substrate | - | 0.8014 | 80.14% |
CYP2D6 substrate | - | 0.8443 | 84.43% |
CYP3A4 inhibition | - | 0.9120 | 91.20% |
CYP2C9 inhibition | - | 0.8116 | 81.16% |
CYP2C19 inhibition | - | 0.7397 | 73.97% |
CYP2D6 inhibition | - | 0.8881 | 88.81% |
CYP1A2 inhibition | - | 0.7553 | 75.53% |
CYP2C8 inhibition | + | 0.6435 | 64.35% |
CYP inhibitory promiscuity | - | 0.9569 | 95.69% |
UGT catelyzed | + | 1.0000 | 100.00% |
Carcinogenicity (binary) | - | 0.6000 | 60.00% |
Carcinogenicity (trinary) | Non-required | 0.6188 | 61.88% |
Eye corrosion | - | 0.9723 | 97.23% |
Eye irritation | - | 0.9256 | 92.56% |
Skin irritation | - | 0.7673 | 76.73% |
Skin corrosion | - | 0.9054 | 90.54% |
Ames mutagenesis | - | 0.5037 | 50.37% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.6753 | 67.53% |
Micronuclear | + | 0.5700 | 57.00% |
Hepatotoxicity | - | 0.5834 | 58.34% |
skin sensitisation | - | 0.8593 | 85.93% |
Respiratory toxicity | + | 0.7444 | 74.44% |
Reproductive toxicity | + | 0.7667 | 76.67% |
Mitochondrial toxicity | + | 0.5250 | 52.50% |
Nephrotoxicity | - | 0.8976 | 89.76% |
Acute Oral Toxicity (c) | III | 0.5739 | 57.39% |
Estrogen receptor binding | + | 0.7106 | 71.06% |
Androgen receptor binding | + | 0.7409 | 74.09% |
Thyroid receptor binding | - | 0.6126 | 61.26% |
Glucocorticoid receptor binding | + | 0.5970 | 59.70% |
Aromatase binding | + | 0.5922 | 59.22% |
PPAR gamma | + | 0.6018 | 60.18% |
Honey bee toxicity | - | 0.6588 | 65.88% |
Biodegradation | - | 0.6500 | 65.00% |
Crustacea aquatic toxicity | + | 0.5045 | 50.45% |
Fish aquatic toxicity | + | 0.9710 | 97.10% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.89% | 96.09% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 98.23% | 92.98% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 97.91% | 95.93% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 97.55% | 85.31% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 96.75% | 96.77% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.68% | 97.25% |
CHEMBL2581 | P07339 | Cathepsin D | 93.25% | 98.95% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 93.08% | 100.00% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 92.97% | 96.38% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.58% | 97.09% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 92.32% | 93.18% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 91.31% | 92.86% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 91.16% | 95.71% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 90.91% | 94.75% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 90.88% | 89.05% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.54% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.07% | 95.56% |
CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 88.00% | 94.66% |
CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 87.95% | 99.17% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.63% | 90.71% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 87.60% | 98.05% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.98% | 91.11% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 86.78% | 96.90% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.42% | 85.14% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.25% | 96.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.21% | 97.14% |
CHEMBL2959 | Q08881 | Tyrosine-protein kinase ITK/TSK | 86.17% | 95.00% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 85.68% | 95.58% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 85.20% | 82.69% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 85.03% | 94.33% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 85.00% | 96.47% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.70% | 95.50% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.11% | 92.94% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.18% | 93.56% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 83.10% | 99.18% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 82.99% | 100.00% |
CHEMBL1871 | P10275 | Androgen Receptor | 82.97% | 96.43% |
CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 82.68% | 96.25% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.37% | 89.00% |
CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 81.86% | 92.78% |
CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 81.75% | 96.00% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 81.68% | 100.00% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.66% | 95.83% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 81.36% | 82.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.01% | 95.89% |
CHEMBL1795117 | Q8TEK3 | Histone-lysine N-methyltransferase, H3 lysine-79 specific | 80.77% | 93.56% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.60% | 92.50% |
CHEMBL4105786 | P41182 | B-cell lymphoma 6 protein | 80.50% | 92.86% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lippia origanoides |