4,5-Dihydroxy-1,2-dimethoxy-7-methylanthracene-9,10-dione
| Internal ID | c666aae6-3d85-43db-834c-48e6ba25e465 |
| Taxonomy | Benzenoids > Anthracenes > Anthraquinones |
| IUPAC Name | 4,5-dihydroxy-1,2-dimethoxy-7-methylanthracene-9,10-dione |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C17H14O6/c1-7-4-8-12(9(18)5-7)16(21)13-10(19)6-11(22-2)17(23-3)14(13)15(8)20/h4-6,18-19H,1-3H3 |
| InChI Key | XEWRTZLESCLJSY-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C17H14O6 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.07903816 g/mol |
| Topological Polar Surface Area (TPSA) | 93.10 Ų |
| XlogP | 3.00 |
| DTXSID70754987 |
| 4,5-Dihydroxy-1,2-dimethoxy-7-methylanthracene-9,10-dione |
| RefChem:96495 |
| DTXCID10705731 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.76% | 95.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.60% | 99.23% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.55% | 94.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.33% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.86% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.59% | 98.95% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.20% | 90.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.74% | 96.09% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.67% | 99.15% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.09% | 85.14% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.88% | 86.33% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.03% | 98.75% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.05% | 94.75% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.39% | 96.00% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 80.75% | 91.00% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 80.58% | 96.67% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.40% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ventilago denticulata |
| PubChem | 71325691 |
| LOTUS | LTS0085422 |
| wikiData | Q82706440 |