4,4a,6a,6b,8a,11,11,14a-octamethyl-5,6,6a,7,8,9,10,12,12a,13,14,14b-dodecahydro-4H-picen-3-one
Internal ID | a821a0cd-a693-41a3-affd-094c5cf4c243 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | 4,4a,6a,6b,8a,11,11,14a-octamethyl-5,6,6a,7,8,9,10,12,12a,13,14,14b-dodecahydro-4H-picen-3-one |
SMILES (Canonical) | CC1C(=O)C=CC2C1(CCC3C2(CCC4(C3(CCC5(C4CC(CC5)(C)C)C)C)C)C)C |
SMILES (Isomeric) | CC1C(=O)C=CC2C1(CCC3C2(CCC4(C3(CCC5(C4CC(CC5)(C)C)C)C)C)C)C |
InChI | InChI=1S/C30H48O/c1-20-21(31)9-10-22-27(20,5)12-11-23-28(22,6)16-18-30(8)24-19-25(2,3)13-14-26(24,4)15-17-29(23,30)7/h9-10,20,22-24H,11-19H2,1-8H3 |
InChI Key | MBWGRAHRCWMYAX-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H48O |
Molecular Weight | 424.70 g/mol |
Exact Mass | 424.370516150 g/mol |
Topological Polar Surface Area (TPSA) | 17.10 Ų |
XlogP | 9.80 |
There are no found synonyms. |
![2D Structure of 4,4a,6a,6b,8a,11,11,14a-octamethyl-5,6,6a,7,8,9,10,12,12a,13,14,14b-dodecahydro-4H-picen-3-one 2D Structure of 4,4a,6a,6b,8a,11,11,14a-octamethyl-5,6,6a,7,8,9,10,12,12a,13,14,14b-dodecahydro-4H-picen-3-one](https://plantaedb.com/storage/docs/compounds/2023/11/44a6a6b8a111114a-octamethyl-566a789101212a131414b-dodecahydro-4h-picen-3-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.59% | 97.25% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 92.11% | 82.69% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.37% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.26% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.82% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.50% | 97.09% |
CHEMBL2581 | P07339 | Cathepsin D | 87.90% | 98.95% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 87.39% | 94.75% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.28% | 100.00% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 85.66% | 96.38% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.32% | 90.17% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.85% | 95.89% |
CHEMBL1871 | P10275 | Androgen Receptor | 81.56% | 96.43% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 81.52% | 85.30% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.44% | 92.94% |
CHEMBL2916 | O14746 | Telomerase reverse transcriptase | 81.42% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Guazuma ulmifolia |
PubChem | 23222909 |
LOTUS | LTS0064238 |
wikiData | Q105160985 |