[(1R,2R,4R,6R,7S,9S,10R,11R)-17-hydroxy-6-[(2R)-2-hydroxy-5-oxo-2H-furan-4-yl]-1,7,11,15,15-pentamethyl-14,18-dioxo-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadec-16-en-9-yl] acetate
| Internal ID | 13181e09-9533-46cd-815d-208a8697be15 |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid lactones |
| IUPAC Name | [(1R,2R,4R,6R,7S,9S,10R,11R)-17-hydroxy-6-[(2R)-2-hydroxy-5-oxo-2H-furan-4-yl]-1,7,11,15,15-pentamethyl-14,18-dioxo-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadec-16-en-9-yl] acetate |
| SMILES (Canonical) | CC(=O)OC1CC2(C(CC3C2(O3)C4(C1C5(CCC(=O)C(C5=C(C4=O)O)(C)C)C)C)C6=CC(OC6=O)O)C |
| SMILES (Isomeric) | CC(=O)O[C@H]1C[C@]2([C@@H](C[C@@H]3[C@]2(O3)[C@]4([C@H]1[C@]5(CCC(=O)C(C5=C(C4=O)O)(C)C)C)C)C6=C[C@@H](OC6=O)O)C |
| InChI | InChI=1S/C28H34O9/c1-12(29)35-15-11-26(5)14(13-9-18(31)36-23(13)34)10-17-28(26,37-17)27(6)20(15)25(4)8-7-16(30)24(2,3)21(25)19(32)22(27)33/h9,14-15,17-18,20,31-32H,7-8,10-11H2,1-6H3/t14-,15-,17+,18+,20+,25+,26-,27-,28+/m0/s1 |
| InChI Key | CQFCSBKVVFDVBS-ULRSGXBGSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C28H34O9 |
| Molecular Weight | 514.60 g/mol |
| Exact Mass | 514.22028266 g/mol |
| Topological Polar Surface Area (TPSA) | 140.00 Ų |
| XlogP | 1.60 |
| There are no found synonyms. |
![2D Structure of [(1R,2R,4R,6R,7S,9S,10R,11R)-17-hydroxy-6-[(2R)-2-hydroxy-5-oxo-2H-furan-4-yl]-1,7,11,15,15-pentamethyl-14,18-dioxo-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadec-16-en-9-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/44349150-83e2-11ee-b341-11a954da8687.jpg "2D Structure of [(1R,2R,4R,6R,7S,9S,10R,11R)-17-hydroxy-6-[(2R)-2-hydroxy-5-oxo-2H-furan-4-yl]-1,7,11,15,15-pentamethyl-14,18-dioxo-3-oxapentacyclo[8.8.0.02,4.02,7.011,16]octadec-16-en-9-yl] acetate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.50% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.11% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.53% | 85.14% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.46% | 97.09% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 92.92% | 90.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.07% | 94.45% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.00% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.46% | 95.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.90% | 99.23% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.22% | 98.95% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.49% | 91.19% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.06% | 100.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.77% | 94.00% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.35% | 96.95% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 81.87% | 97.79% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.10% | 92.62% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.83% | 91.07% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Walsura pinnata |
| PubChem | 163103720 |
| LOTUS | LTS0078835 |
| wikiData | Q104967953 |