2-[4,5-Dihydroxy-6-(hydroxymethyl)-2-[[7,9,13-trimethyl-6-[3-methyl-4-(3,4,5-trihydroxy-6-methoxyoxan-2-yl)oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-6-en-16-yl]oxy]oxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol
Internal ID | bc106004-0094-4367-bb96-96634dc10d71 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | 2-[4,5-dihydroxy-6-(hydroxymethyl)-2-[[7,9,13-trimethyl-6-[3-methyl-4-(3,4,5-trihydroxy-6-methoxyoxan-2-yl)oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-6-en-16-yl]oxy]oxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | CC1=C(OC2C1C3(CCC4C(C3C2)CCC5C4(CCC(C5)OC6C(C(C(C(O6)CO)O)O)OC7C(C(C(C(O7)CO)O)O)O)C)C)CCC(C)COC8C(C(C(C(O8)OC)O)O)O |
SMILES (Isomeric) | CC1=C(OC2C1C3(CCC4C(C3C2)CCC5C4(CCC(C5)OC6C(C(C(C(O6)CO)O)O)OC7C(C(C(C(O7)CO)O)O)O)C)C)CCC(C)COC8C(C(C(C(O8)OC)O)O)O |
InChI | InChI=1S/C45H74O18/c1-19(18-57-41-37(54)34(51)36(53)40(56-5)63-41)6-9-26-20(2)30-27(59-26)15-25-23-8-7-21-14-22(10-12-44(21,3)24(23)11-13-45(25,30)4)58-43-39(35(52)32(49)29(17-47)61-43)62-42-38(55)33(50)31(48)28(16-46)60-42/h19,21-25,27-43,46-55H,6-18H2,1-5H3 |
InChI Key | BWRKRZSCWJCCDW-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C45H74O18 |
Molecular Weight | 903.10 g/mol |
Exact Mass | 902.48751551 g/mol |
Topological Polar Surface Area (TPSA) | 276.00 Ų |
XlogP | 1.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.00% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.83% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.54% | 97.25% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.49% | 97.09% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 93.46% | 97.79% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.98% | 94.45% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 88.97% | 93.18% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 88.86% | 100.00% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 88.52% | 96.38% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.34% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.08% | 100.00% |
CHEMBL237 | P41145 | Kappa opioid receptor | 87.45% | 98.10% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 87.13% | 96.21% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 86.62% | 92.86% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 86.23% | 95.58% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.85% | 95.89% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.74% | 94.00% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 84.68% | 96.47% |
CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 84.34% | 95.36% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 83.81% | 95.93% |
CHEMBL233 | P35372 | Mu opioid receptor | 83.41% | 97.93% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.68% | 92.94% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.59% | 92.50% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 82.15% | 98.05% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 81.92% | 97.64% |
CHEMBL2782 | P35610 | Acyl coenzyme A:cholesterol acyltransferase 1 | 81.43% | 91.65% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 81.41% | 96.61% |
CHEMBL1871 | P10275 | Androgen Receptor | 80.93% | 96.43% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.27% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Asparagus officinalis |
PubChem | 162963986 |
LOTUS | LTS0138779 |
wikiData | Q104947562 |