5-(4-hydroxy-3,5-dimethoxyphenyl)-5,8,8a,9-tetrahydrofuro[3',4':6,7]naphtho[2,3-d][1,3]dioxol-6(5aH)-one
Internal ID | 80d2cc1f-cc36-4c63-b958-46f84ab2432d |
Taxonomy | Lignans, neolignans and related compounds > Lignan lactones |
IUPAC Name | 5-(4-hydroxy-3,5-dimethoxyphenyl)-5a,8,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-6-one |
SMILES (Canonical) | COC1=CC(=CC(=C1O)OC)C2C3C(CC4=CC5=C(C=C24)OCO5)COC3=O |
SMILES (Isomeric) | COC1=CC(=CC(=C1O)OC)C2C3C(CC4=CC5=C(C=C24)OCO5)COC3=O |
InChI | InChI=1S/C21H20O7/c1-24-16-5-11(6-17(25-2)20(16)22)18-13-7-15-14(27-9-28-15)4-10(13)3-12-8-26-21(23)19(12)18/h4-7,12,18-19,22H,3,8-9H2,1-2H3 |
InChI Key | RFDMNXDDRXVJTM-UHFFFAOYSA-N |
Popularity | 4 references in papers |
Molecular Formula | C21H20O7 |
Molecular Weight | 384.40 g/mol |
Exact Mass | 384.12090297 g/mol |
Topological Polar Surface Area (TPSA) | 83.40 Ų |
XlogP | 2.80 |
5-(4-hydroxy-3,5-dimethoxyphenyl)-5,8,8a,9-tetrahydrofuro[3',4':6,7]naphtho[2,3-d][1,3]dioxol-6(5aH)-one |
MLS002701748 |
NSC267714 |
CHEMBL1707682 |
SCHEMBL16552232 |
MFCD29654635 |
NSC-267714 |
SMR001565344 |
856581-34-5 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.29% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.83% | 85.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.81% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.85% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.69% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.45% | 95.56% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 91.21% | 92.62% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 90.50% | 83.82% |
CHEMBL2581 | P07339 | Cathepsin D | 90.47% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.04% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.72% | 95.89% |
CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 86.54% | 96.86% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.91% | 97.09% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.88% | 90.71% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.26% | 94.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.07% | 95.89% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 81.88% | 96.77% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.83% | 100.00% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.69% | 89.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Condea verticillata |
Podophyllum hexandrum |
Podophyllum peltatum |
PubChem | 1689 |
LOTUS | LTS0135166 |
wikiData | Q105235320 |