[(3S,4aR,6aR,6aS,8aR,12aR,14aR,14bS)-4,4,6a,6a,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,8,9,10,12,12a,13,14,14a-tetradecahydropicen-3-yl] (Z)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate
Internal ID | 29bf0e19-fbf5-4f9c-984f-7e66e3733f4b |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesterterpenoids > Scalarane sesterterpenoids |
IUPAC Name | [(3S,4aR,6aR,6aS,8aR,12aR,14aR,14bS)-4,4,6a,6a,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,8,9,10,12,12a,13,14,14a-tetradecahydropicen-3-yl] (Z)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
SMILES (Canonical) | CC1(CCC2(CC=C3C4(CCC5C(C(CCC5(C4CCC3(C2C1)C)C)OC(=O)C=CC6=CC(=C(C=C6)O)OC)(C)C)C)C)C |
SMILES (Isomeric) | C[C@]12CCC(C[C@H]1[C@@]3(CC[C@@H]4[C@@]5(CC[C@@H](C([C@@H]5CC[C@]4(C3=CC2)C)(C)C)OC(=O)/C=C\C6=CC(=C(C=C6)O)OC)C)C)(C)C |
InChI | InChI=1S/C40H58O4/c1-35(2)22-23-37(5)18-14-30-39(7)19-15-29-36(3,4)33(44-34(42)13-11-26-10-12-27(41)28(24-26)43-9)17-21-38(29,6)31(39)16-20-40(30,8)32(37)25-35/h10-14,24,29,31-33,41H,15-23,25H2,1-9H3/b13-11-/t29-,31+,32+,33-,37-,38+,39-,40+/m0/s1 |
InChI Key | HKZGZNSIWGBZTM-NYPDAYKXSA-N |
Popularity | 0 references in papers |
Molecular Formula | C40H58O4 |
Molecular Weight | 602.90 g/mol |
Exact Mass | 602.43351033 g/mol |
Topological Polar Surface Area (TPSA) | 55.80 Ų |
XlogP | 11.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.63% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.14% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.63% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.54% | 95.56% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 92.41% | 92.94% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.29% | 86.33% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 91.85% | 89.62% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 91.24% | 85.30% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.54% | 89.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.17% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.09% | 97.09% |
CHEMBL3194 | P02766 | Transthyretin | 88.99% | 90.71% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 87.74% | 91.03% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 87.50% | 91.07% |
CHEMBL2535 | P11166 | Glucose transporter | 87.35% | 98.75% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.33% | 92.62% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.80% | 96.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.23% | 100.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.06% | 97.14% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.61% | 95.50% |
CHEMBL3788 | O00444 | Serine/threonine-protein kinase PLK4 | 82.56% | 83.65% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.86% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Bruguiera cylindrica |
PubChem | 162963904 |
LOTUS | LTS0234068 |
wikiData | Q105030035 |