[(2R,3R,4R,5R,6S)-6-[2-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxo-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-3-yl]oxy-4,5-dihydroxy-2-[[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-3-yl] (E)-3-(4-hydroxyphenyl)prop-2-enoate
Internal ID | ae37d29b-9fc5-4026-afed-9d373e3c8037 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | [(2R,3R,4R,5R,6S)-6-[2-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxo-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-3-yl]oxy-4,5-dihydroxy-2-[[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-3-yl] (E)-3-(4-hydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=C(OC4=CC(=CC(=C4C3=O)O)OC5C(C(C(C(O5)CO)O)O)O)C6=CC(=C(C=C6)O)O)O)O)OC(=O)C=CC7=CC=C(C=C7)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@H](O1)OC[C@@H]2[C@@H]([C@@H]([C@H]([C@@H](O2)OC3=C(OC4=CC(=CC(=C4C3=O)O)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)C6=CC(=C(C=C6)O)O)O)O)OC(=O)/C=C/C7=CC=C(C=C7)O)O)O)O |
InChI | InChI=1S/C42H46O23/c1-15-28(49)31(52)34(55)40(59-15)58-14-25-38(64-26(48)9-4-16-2-6-18(44)7-3-16)33(54)36(57)42(63-25)65-39-30(51)27-22(47)11-19(60-41-35(56)32(53)29(50)24(13-43)62-41)12-23(27)61-37(39)17-5-8-20(45)21(46)10-17/h2-12,15,24-25,28-29,31-36,38,40-47,49-50,52-57H,13-14H2,1H3/b9-4+/t15-,24+,25+,28-,29+,31+,32-,33+,34+,35+,36+,38-,40-,41+,42-/m0/s1 |
InChI Key | MTAIYYRXJVZTFX-SQNBTRIWSA-N |
Popularity | 0 references in papers |
Molecular Formula | C42H46O23 |
Molecular Weight | 918.80 g/mol |
Exact Mass | 918.24298771 g/mol |
Topological Polar Surface Area (TPSA) | 371.00 Ų |
XlogP | -0.80 |
There are no found synonyms. |
![2D Structure of [(2R,3R,4R,5R,6S)-6-[2-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxo-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-3-yl]oxy-4,5-dihydroxy-2-[[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-3-yl] (E)-3-(4-hydroxyphenyl)prop-2-enoate 2D Structure of [(2R,3R,4R,5R,6S)-6-[2-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxo-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-3-yl]oxy-4,5-dihydroxy-2-[[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-3-yl] (E)-3-(4-hydroxyphenyl)prop-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/42fb1990-84f8-11ee-a0fc-072cfc9916f6.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.81% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.46% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 98.88% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 98.23% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 96.50% | 98.95% |
CHEMBL3194 | P02766 | Transthyretin | 93.47% | 90.71% |
CHEMBL3401 | O75469 | Pregnane X receptor | 93.27% | 94.73% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.26% | 97.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.86% | 99.15% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.64% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.18% | 96.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.99% | 96.00% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 90.87% | 86.92% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.59% | 95.56% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 88.96% | 94.80% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 88.92% | 98.35% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 87.34% | 80.78% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.17% | 90.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 85.59% | 97.36% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 83.62% | 95.78% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 83.61% | 91.71% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 83.52% | 95.64% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 82.48% | 85.14% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.50% | 94.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.45% | 95.89% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.86% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Strychnos variabilis |
PubChem | 163195094 |
LOTUS | LTS0194514 |
wikiData | Q105171569 |