3-[4-[(1S,2S)-1-hydroxy-1-(4-hydroxy-3-methoxyphenyl)-3-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxypropan-2-yl]oxy-3,5-dimethoxyphenyl]propyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate
Internal ID | 86a5408a-3ff2-4521-baa8-a2cf3bf77b76 |
Taxonomy | Lignans, neolignans and related compounds |
IUPAC Name | 3-[4-[(1S,2S)-1-hydroxy-1-(4-hydroxy-3-methoxyphenyl)-3-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxypropan-2-yl]oxy-3,5-dimethoxyphenyl]propyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
SMILES (Canonical) | COC1=CC(=CC(=C1OC(COC(=O)C=CC2=CC(=C(C=C2)O)OC)C(C3=CC(=C(C=C3)O)OC)O)OC)CCCOC(=O)C=CC4=CC(=C(C=C4)O)OC |
SMILES (Isomeric) | COC1=CC(=CC(=C1O[C@@H](COC(=O)/C=C/C2=CC(=C(C=C2)O)OC)[C@H](C3=CC(=C(C=C3)O)OC)O)OC)CCCOC(=O)/C=C/C4=CC(=C(C=C4)O)OC |
InChI | InChI=1S/C41H44O14/c1-48-32-19-25(8-13-29(32)42)10-16-38(45)53-18-6-7-27-21-35(51-4)41(36(22-27)52-5)55-37(40(47)28-12-15-31(44)34(23-28)50-3)24-54-39(46)17-11-26-9-14-30(43)33(20-26)49-2/h8-17,19-23,37,40,42-44,47H,6-7,18,24H2,1-5H3/b16-10+,17-11+/t37-,40-/m0/s1 |
InChI Key | BSLKCEWIHPETHH-OSDGHTTJSA-N |
Popularity | 0 references in papers |
Molecular Formula | C41H44O14 |
Molecular Weight | 760.80 g/mol |
Exact Mass | 760.27310607 g/mol |
Topological Polar Surface Area (TPSA) | 189.00 Ų |
XlogP | 6.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.71% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.32% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.75% | 99.17% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 96.36% | 96.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.07% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 94.79% | 98.95% |
CHEMBL3194 | P02766 | Transthyretin | 92.16% | 90.71% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.06% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.55% | 89.00% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 90.32% | 89.62% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.45% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.79% | 85.14% |
CHEMBL2535 | P11166 | Glucose transporter | 87.40% | 98.75% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.82% | 90.71% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 86.43% | 92.98% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 86.15% | 91.71% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.99% | 95.89% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 85.49% | 95.17% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 85.29% | 85.31% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.88% | 90.00% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 81.68% | 89.50% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.33% | 99.15% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Hibiscus cannabinus |
PubChem | 101114361 |
LOTUS | LTS0088959 |
wikiData | Q104945291 |