4-[(1Z)-1-(4-methoxyphenyl)penta-1,4-dien-3-yl]phenol
| Internal ID | 0d256622-1664-4d53-b5c2-82f2cbaffb5c |
| Taxonomy | Lignans, neolignans and related compounds |
| IUPAC Name | 4-[(1Z)-1-(4-methoxyphenyl)penta-1,4-dien-3-yl]phenol |
| SMILES (Canonical) | COC1=CC=C(C=C1)C=CC(C=C)C2=CC=C(C=C2)O |
| SMILES (Isomeric) | COC1=CC=C(C=C1)/C=C\C(C=C)C2=CC=C(C=C2)O |
| InChI | InChI=1S/C18H18O2/c1-3-15(16-8-10-17(19)11-9-16)7-4-14-5-12-18(20-2)13-6-14/h3-13,15,19H,1H2,2H3/b7-4- |
| InChI Key | MTYGOTBQCBXZQD-DAXSKMNVSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H18O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.130679813 g/mol |
| Topological Polar Surface Area (TPSA) | 29.50 Ų |
| XlogP | 4.70 |
| 4-[(Z)-1-Vinyl-3-(4-methoxyphenyl)-2-propenyl]phenol |
![2D Structure of 4-[(1Z)-1-(4-methoxyphenyl)penta-1,4-dien-3-yl]phenol](https://plantaedb.com/storage/docs/compounds/2023/07/4-z-1-vinyl-3-4-methoxyphenyl-2-propenylphenol.jpg "2D Structure of 4-[(1Z)-1-(4-methoxyphenyl)penta-1,4-dien-3-yl]phenol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.58% | 91.11% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 96.30% | 98.35% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.22% | 95.56% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 91.13% | 96.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 90.94% | 90.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.07% | 96.09% |
| CHEMBL211 | P08172 | Muscarinic acetylcholine receptor M2 | 88.83% | 94.97% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.27% | 99.17% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 87.66% | 93.99% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 87.29% | 91.49% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 86.29% | 93.31% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.60% | 86.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.43% | 94.45% |
| CHEMBL2535 | P11166 | Glucose transporter | 83.06% | 98.75% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 82.39% | 93.10% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 80.56% | 94.08% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Anemarrhena asphodeloides |
| Angelica dahurica |
| Cremanthodium ellisii |
| PubChem | 5319736 |
| NPASS | NPC136244 |
| LOTUS | LTS0070239 |
| wikiData | Q105171976 |