4-O-methylxanthohumol
Internal ID | 08699499-f657-41a9-b8cc-a84d2a4b948e |
Taxonomy | Phenylpropanoids and polyketides > Linear 1,3-diarylpropanoids > Chalcones and dihydrochalcones > 3-prenylated chalcones |
IUPAC Name | (E)-1-[2,4-dihydroxy-6-methoxy-3-(3-methylbut-2-enyl)phenyl]-3-(4-methoxyphenyl)prop-2-en-1-one |
SMILES (Canonical) | CC(=CCC1=C(C(=C(C=C1O)OC)C(=O)C=CC2=CC=C(C=C2)OC)O)C |
SMILES (Isomeric) | CC(=CCC1=C(C(=C(C=C1O)OC)C(=O)/C=C/C2=CC=C(C=C2)OC)O)C |
InChI | InChI=1S/C22H24O5/c1-14(2)5-11-17-19(24)13-20(27-4)21(22(17)25)18(23)12-8-15-6-9-16(26-3)10-7-15/h5-10,12-13,24-25H,11H2,1-4H3/b12-8+ |
InChI Key | HOOCUUOYPZNVKX-XYOKQWHBSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C22H24O5 |
Molecular Weight | 368.40 g/mol |
Exact Mass | 368.16237386 g/mol |
Topological Polar Surface Area (TPSA) | 76.00 Ų |
XlogP | 5.40 |
(2E)-1-[2,4-dihydroxy-6-methoxy-3-(3-methylbut-2-en-1-yl)phenyl]-3-(4-methoxyphenyl)prop-2-en-1-one |
CHEMBL1165313 |
CHEBI:139593 |
C22048 |
(E)-1-[2,4-dihydroxy-6-methoxy-3-(3-methylbut-2-enyl)phenyl]-3-(4-methoxyphenyl)prop-2-en-1-one |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.00% | 91.11% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 96.02% | 96.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.47% | 86.33% |
CHEMBL4208 | P20618 | Proteasome component C5 | 94.12% | 90.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.51% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.77% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.67% | 99.17% |
CHEMBL3194 | P02766 | Transthyretin | 90.38% | 90.71% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.59% | 93.99% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.37% | 95.50% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.83% | 85.14% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.96% | 99.15% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.77% | 94.73% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.33% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 82.87% | 98.95% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.53% | 91.07% |
CHEMBL2535 | P11166 | Glucose transporter | 80.04% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 23251192 |
NPASS | NPC25287 |
ChEMBL | CHEMBL1165313 |