4'-O-Glucosylisoswertisin
Internal ID | 89715c01-77ae-445b-a886-e00a20d7577c |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides |
IUPAC Name | 5-hydroxy-7-methoxy-8-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-2-[4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]chromen-4-one |
SMILES (Canonical) | COC1=C(C2=C(C(=C1)O)C(=O)C=C(O2)C3=CC=C(C=C3)OC4C(C(C(C(O4)CO)O)O)O)C5C(C(C(C(O5)CO)O)O)O |
SMILES (Isomeric) | COC1=C(C2=C(C(=C1)O)C(=O)C=C(O2)C3=CC=C(C=C3)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O |
InChI | InChI=1S/C28H32O15/c1-39-15-7-13(32)18-12(31)6-14(41-26(18)19(15)27-24(37)22(35)20(33)16(8-29)42-27)10-2-4-11(5-3-10)40-28-25(38)23(36)21(34)17(9-30)43-28/h2-7,16-17,20-25,27-30,32-38H,8-9H2,1H3/t16-,17-,20-,21-,22+,23+,24-,25-,27+,28-/m1/s1 |
InChI Key | ZCDDNVDFOHBRBE-QQUSBYFVSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H32O15 |
Molecular Weight | 608.50 g/mol |
Exact Mass | 608.17412031 g/mol |
Topological Polar Surface Area (TPSA) | 245.00 Ų |
XlogP | -1.30 |
DTXSID501311910 |
35480-14-9 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.28% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 98.06% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 96.52% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.05% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.97% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.76% | 95.56% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.33% | 99.15% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.62% | 99.17% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 90.14% | 86.92% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.14% | 97.09% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 87.96% | 96.21% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.29% | 96.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.24% | 95.89% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.37% | 94.73% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.94% | 96.00% |
CHEMBL1907 | P15144 | Aminopeptidase N | 83.15% | 93.31% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.19% | 90.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.92% | 92.62% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.79% | 85.14% |
CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 80.88% | 89.23% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.63% | 97.14% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 80.39% | 97.36% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Triticum aestivum |
PubChem | 102147867 |
LOTUS | LTS0216581 |
wikiData | Q105371040 |