4-Methyltetracosane
| Internal ID | 437c06f6-1011-452e-9271-47c8df4af8c3 |
| Taxonomy | Hydrocarbons > Saturated hydrocarbons > Alkanes > Branched alkanes |
| IUPAC Name | 4-methyltetracosane |
| SMILES (Canonical) | CCCCCCCCCCCCCCCCCCCCC(C)CCC |
| SMILES (Isomeric) | CCCCCCCCCCCCCCCCCCCCC(C)CCC |
| InChI | InChI=1S/C25H52/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-24-25(3)23-5-2/h25H,4-24H2,1-3H3 |
| InChI Key | ZMWYRLCLGPLJAE-UHFFFAOYSA-N |
| Popularity | 8 references in papers |
| Molecular Formula | C25H52 |
| Molecular Weight | 352.70 g/mol |
| Exact Mass | 352.406901659 g/mol |
| Topological Polar Surface Area (TPSA) | 0.00 Ų |
| XlogP | 13.50 |
| Tetracosane, 4-methyl |
| 76275-83-7 |
| DTXSID70335811 |
| ZMWYRLCLGPLJAE-UHFFFAOYSA-N |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 95.32% | 92.86% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 94.88% | 97.29% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 94.87% | 89.63% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.85% | 98.95% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 92.34% | 87.45% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 91.74% | 85.94% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 90.35% | 92.08% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 90.21% | 93.31% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 89.99% | 91.81% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 89.44% | 97.79% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.78% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.66% | 97.25% |
| CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 87.35% | 90.24% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.47% | 93.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.45% | 99.17% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 84.73% | 98.03% |
| CHEMBL4105838 | Q96GG9 | DCN1-like protein 1 | 84.53% | 95.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.05% | 90.17% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.00% | 100.00% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 80.05% | 97.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Hamamelis virginiana |
| PubChem | 527470 |
| LOTUS | LTS0219723 |
| wikiData | Q82102450 |