4-Methyl-L-glutamate
| Internal ID | bdeab1b8-8e5c-4ef4-a336-5ac811053aed |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives > Alpha amino acids > L-alpha-amino acids |
| IUPAC Name | (2S)-2-amino-4-methylpentanedioic acid |
| SMILES (Canonical) | CC(CC(C(=O)O)N)C(=O)O |
| SMILES (Isomeric) | CC(C[C@@H](C(=O)O)N)C(=O)O |
| InChI | InChI=1S/C6H11NO4/c1-3(5(8)9)2-4(7)6(10)11/h3-4H,2,7H2,1H3,(H,8,9)(H,10,11)/t3?,4-/m0/s1 |
| InChI Key | KRKRAOXTGDJWNI-BKLSDQPFSA-N |
| Popularity | 38 references in papers |
| Molecular Formula | C6H11NO4 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.06880783 g/mol |
| Topological Polar Surface Area (TPSA) | 101.00 Ų |
| XlogP | -2.90 |
| (2S)-2-amino-4-methylpentanedioic acid |
| Glutamic acid,4-methyl- |
| AC1L9A9Y |
| gamma-methyl-L-glutamic acid |
| CTK4C4624 |
| MLGlu |
| 4-methyl-L-glutamic acid |
| SCHEMBL250314 |
| CHEBI:1893 |
| threo-4-Methyl-L-glutamic Acid |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.15% | 96.09% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.24% | 90.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.14% | 98.95% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 90.65% | 92.29% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 90.31% | 96.95% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 86.77% | 83.82% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 86.54% | 96.47% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 84.27% | 100.00% |
| CHEMBL236 | P41143 | Delta opioid receptor | 84.00% | 99.35% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.94% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Julbernardia paniculata |
| Styphnolobium japonicum |
| PubChem | 440959 |
| LOTUS | LTS0275719 |
| wikiData | Q105145094 |