4-Methoxy-6-[2-(4-methoxyphenyl)ethenyl]-2H-pyran-2-one
Internal ID | f638ec8d-bf99-4f87-9441-dadcabce4621 |
Taxonomy | Phenylpropanoids and polyketides > Kavalactones |
IUPAC Name | 4-methoxy-6-[2-(4-methoxyphenyl)ethenyl]pyran-2-one |
SMILES (Canonical) | COC1=CC=C(C=C1)C=CC2=CC(=CC(=O)O2)OC |
SMILES (Isomeric) | COC1=CC=C(C=C1)C=CC2=CC(=CC(=O)O2)OC |
InChI | InChI=1S/C15H14O4/c1-17-12-6-3-11(4-7-12)5-8-13-9-14(18-2)10-15(16)19-13/h3-10H,1-2H3 |
InChI Key | XLHIYUYCSMZCCC-UHFFFAOYSA-N |
Popularity | 33 references in papers |
Molecular Formula | C15H14O4 |
Molecular Weight | 258.27 g/mol |
Exact Mass | 258.08920892 g/mol |
Topological Polar Surface Area (TPSA) | 44.80 Ų |
XlogP | 2.70 |
4-Methoxy-6-[2-(4-methoxyphenyl)ethenyl]-2H-pyran-2-one |
DTXSID40859418 |
NCI60_001788 |
FT-0675885 |
6-(4-methoxystyryl)-4-methoxy-2h-pyran-2-one |
18693-06-6 |
![2D Structure of 4-Methoxy-6-[2-(4-methoxyphenyl)ethenyl]-2H-pyran-2-one 2D Structure of 4-Methoxy-6-[2-(4-methoxyphenyl)ethenyl]-2H-pyran-2-one](https://plantaedb.com/storage/docs/compounds/2023/11/4-methoxy-6-2-4-methoxyphenylethenyl-2h-pyran-2-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.05% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.74% | 95.56% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 95.16% | 96.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.38% | 86.33% |
CHEMBL1907 | P15144 | Aminopeptidase N | 87.57% | 93.31% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.45% | 90.00% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 86.19% | 93.99% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.22% | 94.73% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.37% | 94.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.85% | 99.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.80% | 94.45% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.73% | 91.07% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Piper methysticum |
PubChem | 10375 |
LOTUS | LTS0065609 |
wikiData | Q105329981 |