4-Methoxy-5-methyl-2H-chromen-2-one
| Internal ID | 422d095f-380f-4deb-8dbc-e754113097e3 |
| Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives |
| IUPAC Name | 4-methoxy-5-methylchromen-2-one |
| SMILES (Canonical) | CC1=C2C(=CC=C1)OC(=O)C=C2OC |
| SMILES (Isomeric) | CC1=C2C(=CC=C1)OC(=O)C=C2OC |
| InChI | InChI=1S/C11H10O3/c1-7-4-3-5-8-11(7)9(13-2)6-10(12)14-8/h3-6H,1-2H3 |
| InChI Key | IKXIGRLJWISHNK-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C11H10O3 |
| Molecular Weight | 190.19 g/mol |
| Exact Mass | 190.062994177 g/mol |
| Topological Polar Surface Area (TPSA) | 35.50 Ų |
| XlogP | 2.00 |
| 53091-74-0 |
| Ekersenin |
| 4-Methoxy-5-methylcoumarin |
| HY-N11509 |
| 4-METHOXY-5-METHYLCHROMEN-2-ONE |
| CS-0648417 |
| E80585 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.19% | 95.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.78% | 94.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.30% | 91.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.72% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.85% | 98.95% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 89.29% | 93.99% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.25% | 94.73% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.89% | 94.45% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.87% | 98.75% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 86.84% | 94.45% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 86.08% | 93.65% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 85.18% | 93.31% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.83% | 99.23% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.84% | 96.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.69% | 89.00% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 82.06% | 94.03% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 80.46% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Clutia abyssinica |
| Ekebergia capensis |
| PubChem | 12637481 |
| LOTUS | LTS0067879 |
| wikiData | Q105114991 |