4-Isopropyl-2-methylphenol
| Internal ID | 9bc41d3e-b1ba-4be4-96aa-760a2d46fc29 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Cumenes |
| IUPAC Name | 2-methyl-4-propan-2-ylphenol |
| SMILES (Canonical) | CC1=C(C=CC(=C1)C(C)C)O |
| SMILES (Isomeric) | CC1=C(C=CC(=C1)C(C)C)O |
| InChI | InChI=1S/C10H14O/c1-7(2)9-4-5-10(11)8(3)6-9/h4-7,11H,1-3H3 |
| InChI Key | WYXXLXHHWYNKJF-UHFFFAOYSA-N |
| Popularity | 10 references in papers |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.104465066 g/mol |
| Topological Polar Surface Area (TPSA) | 20.20 Ų |
| XlogP | 3.10 |
| 1740-97-2 |
| 4-Isopropyl-o-cresol |
| 2-methyl-4-propan-2-ylphenol |
| Phenol, 2-methyl-4-(1-methylethyl)- |
| 4-Isopropyl-2-methyl-phenol |
| 41Y0OLM4LN |
| EINECS 217-105-4 |
| UNII-41Y0OLM4LN |
| SCHEMBL1397101 |
| DTXSID80169745 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.28% | 91.11% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 96.20% | 99.15% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.03% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.54% | 95.56% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.23% | 90.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.02% | 94.73% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 85.14% | 93.40% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.33% | 93.56% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 84.20% | 93.65% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 83.67% | 90.24% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 82.95% | 89.62% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 82.01% | 97.23% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 81.91% | 100.00% |
| CHEMBL1913 | P09619 | Platelet-derived growth factor receptor beta | 81.00% | 95.70% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Baccharis dracunculifolia |
| Lippia origanoides |
| PubChem | 74446 |
| LOTUS | LTS0159816 |
| wikiData | Q27258472 |