4-Guanidinobutyric acid
| Internal ID | a7a4f449-0c6d-47cc-89d5-74acebf872b0 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Amino acids and derivatives > Gamma amino acids and derivatives |
| IUPAC Name | 4-(diaminomethylideneamino)butanoic acid |
| SMILES (Canonical) | C(CC(=O)O)CN=C(N)N |
| SMILES (Isomeric) | C(CC(=O)O)CN=C(N)N |
| InChI | InChI=1S/C5H11N3O2/c6-5(7)8-3-1-2-4(9)10/h1-3H2,(H,9,10)(H4,6,7,8) |
| InChI Key | TUHVEAJXIMEOSA-UHFFFAOYSA-N |
| Popularity | 172 references in papers |
| Molecular Formula | C5H11N3O2 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.085126602 g/mol |
| Topological Polar Surface Area (TPSA) | 102.00 Ų |
| XlogP | -1.50 |
| 4-guanidinobutanoic acid |
| 463-00-3 |
| gamma-Guanidinobutyric acid |
| 4-carbamimidamidobutanoic acid |
| gamma-guanidinobutyrate |
| 4-guanidinobutanoate |
| 4-(diaminomethylideneamino)butanoic acid |
| 4-(carbamimidamido)butanoic acid |
| UNII-15ADP48O8Q |
| NSC-521717 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.76% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.73% | 99.17% |
| CHEMBL3286 | P00749 | Urokinase-type plasminogen activator | 89.51% | 97.88% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.92% | 91.11% |
| CHEMBL2185 | Q96GD4 | Serine/threonine-protein kinase Aurora-B | 85.03% | 96.80% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 82.54% | 83.82% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Arabidopsis thaliana |
| Arctium lappa |
| Camellia sinensis var. assamica |
| Lunaria annua |
| Malus pumila |
| Pogostemon cablin |
| PubChem | 500 |
| LOTUS | LTS0236153 |
| wikiData | Q27457468 |