4-Formylbenzoic acid
| Internal ID | 442dff29-3d83-474e-919a-8394d20e09bd |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzoic acids and derivatives > Benzoic acids |
| IUPAC Name | 4-formylbenzoic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C8H6O3/c9-5-6-1-3-7(4-2-6)8(10)11/h1-5H,(H,10,11) |
| InChI Key | GOUHYARYYWKXHS-UHFFFAOYSA-N |
| Popularity | 375 references in papers |
| Molecular Formula | C8H6O3 |
| Molecular Weight | 150.13 g/mol |
| Exact Mass | 150.031694049 g/mol |
| Topological Polar Surface Area (TPSA) | 54.40 Ų |
| XlogP | 1.80 |
| 4-Carboxybenzaldehyde |
| 619-66-9 |
| Terephthalaldehydic acid |
| Benzoic acid, 4-formyl- |
| p-Carboxybenzaldehyde |
| p-Formylbenzoic acid |
| Terephthaldehydic acid |
| 4-Formyl-benzoic acid |
| 4-formyl benzoic acid |
| MFCD00006951 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 95.42% | 87.67% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.72% | 95.56% |
| CHEMBL3194 | P02766 | Transthyretin | 92.71% | 90.71% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.56% | 86.33% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 86.51% | 91.49% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.79% | 90.00% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 81.94% | 89.34% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.27% | 93.00% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 81.07% | 81.11% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 80.56% | 100.00% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 80.02% | 90.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Hibiscus taiwanensis |
| PubChem | 12088 |
| LOTUS | LTS0193715 |
| wikiData | Q23662583 |