4-Ethoxy-6-methoxy-2-pentadeca-8,11,14-trienylbenzene-1,3-diol
| Internal ID | 17b19fd7-c24e-4b1c-b81b-4eef09a750a4 |
| Taxonomy | Benzenoids > Phenols > Methoxyphenols |
| IUPAC Name | 4-ethoxy-6-methoxy-2-pentadeca-8,11,14-trienylbenzene-1,3-diol |
| SMILES (Canonical) | CCOC1=C(C(=C(C(=C1)OC)O)CCCCCCCC=CCC=CCC=C)O |
| SMILES (Isomeric) | CCOC1=C(C(=C(C(=C1)OC)O)CCCCCCCC=CCC=CCC=C)O |
| InChI | InChI=1S/C24H36O4/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-20-23(25)21(27-3)19-22(24(20)26)28-5-2/h4,7-8,10-11,19,25-26H,1,5-6,9,12-18H2,2-3H3 |
| InChI Key | SUAPARZKDSPGMY-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.26135963 g/mol |
| Topological Polar Surface Area (TPSA) | 58.90 Ų |
| XlogP | 7.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.04% | 99.17% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 96.18% | 95.17% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 93.98% | 97.21% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.82% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.67% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.99% | 86.33% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 92.59% | 92.94% |
| CHEMBL239 | Q07869 | Peroxisome proliferator-activated receptor alpha | 92.17% | 90.75% |
| CHEMBL240 | Q12809 | HERG | 91.48% | 89.76% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 90.22% | 94.75% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 89.30% | 89.62% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.11% | 98.95% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 88.82% | 96.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.87% | 94.73% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.14% | 95.56% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.58% | 96.00% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 84.71% | 92.08% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 84.22% | 87.45% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 82.82% | 83.57% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 82.06% | 90.24% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.51% | 89.00% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 80.64% | 98.11% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.51% | 90.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.42% | 93.99% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.14% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Sorghum bicolor |
| PubChem | 73076055 |
| LOTUS | LTS0060849 |
| wikiData | Q105260749 |