4-[(E)-2-(3-hydroxy-5-methoxyphenyl)ethenyl]-2-methoxyphenol
| Internal ID | a9fa96ae-8754-4356-8540-66f35fda05da |
| Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
| IUPAC Name | 4-[(E)-2-(3-hydroxy-5-methoxyphenyl)ethenyl]-2-methoxyphenol |
| SMILES (Canonical) | COC1=CC(=CC(=C1)O)C=CC2=CC(=C(C=C2)O)OC |
| SMILES (Isomeric) | COC1=CC(=CC(=C1)O)/C=C/C2=CC(=C(C=C2)O)OC |
| InChI | InChI=1S/C16H16O4/c1-19-14-8-12(7-13(17)10-14)4-3-11-5-6-15(18)16(9-11)20-2/h3-10,17-18H,1-2H3/b4-3+ |
| InChI Key | IVHNUUPSBKWBDI-ONEGZZNKSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.10485899 g/mol |
| Topological Polar Surface Area (TPSA) | 58.90 Ų |
| XlogP | 3.50 |
| There are no found synonyms. |
![2D Structure of 4-[(E)-2-(3-hydroxy-5-methoxyphenyl)ethenyl]-2-methoxyphenol](https://plantaedb.com/storage/docs/compounds/2023/11/4-e-2-3-hydroxy-5-methoxyphenylethenyl-2-methoxyphenol.jpg "2D Structure of 4-[(E)-2-(3-hydroxy-5-methoxyphenyl)ethenyl]-2-methoxyphenol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.14% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.43% | 95.56% |
| CHEMBL3194 | P02766 | Transthyretin | 95.29% | 90.71% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.43% | 96.00% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 92.09% | 92.68% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.15% | 86.33% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.49% | 99.15% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 89.89% | 96.12% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.24% | 90.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.73% | 96.09% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 85.75% | 89.62% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.91% | 99.17% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.49% | 98.75% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.33% | 94.73% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.98% | 89.00% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 80.52% | 100.00% |
| CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 80.34% | 80.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Schizocarphus nervosus |
| Senna didymobotrya |
| PubChem | 15698947 |
| LOTUS | LTS0193513 |
| wikiData | Q105121051 |