4-cyano-3-methoxy-N-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybut-3-enamide
| Internal ID | 4c869edb-e84d-446b-9812-ec17023da1a8 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Cyanogenic glycosides |
| IUPAC Name | 4-cyano-3-methoxy-N-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybut-3-enamide |
| SMILES (Canonical) | CNC(=O)CC(=C(C#N)OC1C(C(C(C(O1)CO)O)O)O)OC |
| SMILES (Isomeric) | CNC(=O)CC(=C(C#N)OC1C(C(C(C(O1)CO)O)O)O)OC |
| InChI | InChI=1S/C13H20N2O8/c1-15-9(17)3-6(21-2)7(4-14)22-13-12(20)11(19)10(18)8(5-16)23-13/h8,10-13,16,18-20H,3,5H2,1-2H3,(H,15,17) |
| InChI Key | BASCBPSXFTXREB-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C13H20N2O8 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.12196560 g/mol |
| Topological Polar Surface Area (TPSA) | 162.00 Ų |
| XlogP | -2.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.27% | 96.09% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 91.44% | 86.92% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.17% | 91.11% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.64% | 96.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.84% | 99.17% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 85.70% | 95.83% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 85.29% | 94.33% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 83.04% | 94.80% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.00% | 94.73% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.12% | 92.50% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 81.12% | 83.82% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Acalypha indica |
| PubChem | 163028032 |
| LOTUS | LTS0216282 |
| wikiData | Q104922388 |