4-[5-(4-Hydroxyphenoxy)pent-3-en-1-ynyl]phenol
Internal ID | 3b8798d3-823f-4e82-9ff9-d1106a5ed4f4 |
Taxonomy | Benzenoids > Phenols > 4-alkoxyphenols |
IUPAC Name | 4-[5-(4-hydroxyphenoxy)pent-3-en-1-ynyl]phenol |
SMILES (Canonical) | C1=CC(=CC=C1C#CC=CCOC2=CC=C(C=C2)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1C#CC=CCOC2=CC=C(C=C2)O)O |
InChI | InChI=1S/C17H14O3/c18-15-7-5-14(6-8-15)4-2-1-3-13-20-17-11-9-16(19)10-12-17/h1,3,5-12,18-19H,13H2 |
InChI Key | GXRXAVMCQJHRCM-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C17H14O3 |
Molecular Weight | 266.29 g/mol |
Exact Mass | 266.094294304 g/mol |
Topological Polar Surface Area (TPSA) | 49.70 Ų |
XlogP | 3.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL242 | Q92731 | Estrogen receptor beta | 96.21% | 98.35% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.54% | 91.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.09% | 99.17% |
CHEMBL2487 | P05067 | Beta amyloid A4 protein | 90.14% | 96.74% |
CHEMBL4208 | P20618 | Proteasome component C5 | 90.12% | 90.00% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 87.00% | 94.62% |
CHEMBL240 | Q12809 | HERG | 85.01% | 89.76% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.92% | 99.15% |
CHEMBL211 | P08172 | Muscarinic acetylcholine receptor M2 | 84.77% | 94.97% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.49% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.41% | 86.33% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 83.31% | 97.53% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.72% | 94.73% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 81.02% | 93.10% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 80.68% | 91.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Asparagus cochinchinensis |
Asparagus officinalis |
PubChem | 53862888 |
LOTUS | LTS0220252 |
wikiData | Q105342375 |