4-(4-Hydroxy-3-methylbut-2-enoxy)benzaldehyde
| Internal ID | eb103f17-ba05-4480-9cb1-9beaf86da240 |
| Taxonomy | Benzenoids > Phenol ethers |
| IUPAC Name | 4-(4-hydroxy-3-methylbut-2-enoxy)benzaldehyde |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C12H14O3/c1-10(8-13)6-7-15-12-4-2-11(9-14)3-5-12/h2-6,9,13H,7-8H2,1H3 |
| InChI Key | HDNZXNSIEVCICP-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.094294304 g/mol |
| Topological Polar Surface Area (TPSA) | 46.50 Ų |
| XlogP | 1.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.74% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.18% | 96.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 90.34% | 90.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 90.25% | 94.73% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.56% | 99.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.05% | 86.33% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 88.24% | 91.49% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.23% | 96.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.63% | 91.11% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 86.11% | 96.12% |
| CHEMBL2581 | P07339 | Cathepsin D | 85.37% | 98.95% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 82.69% | 90.24% |
| CHEMBL2039 | P27338 | Monoamine oxidase B | 81.77% | 92.51% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Zanthoxylum nitidum |
| PubChem | 162892528 |
| LOTUS | LTS0110741 |
| wikiData | Q105026447 |