4-[4-(3-Hydroxyprop-1-enyl)phenoxy]-2-methylbut-2-en-1-ol
Internal ID | b26e536c-c331-4a8e-ba3c-d68a120903e6 |
Taxonomy | Phenylpropanoids and polyketides > Cinnamyl alcohols |
IUPAC Name | 4-[4-(3-hydroxyprop-1-enyl)phenoxy]-2-methylbut-2-en-1-ol |
SMILES (Canonical) | CC(=CCOC1=CC=C(C=C1)C=CCO)CO |
SMILES (Isomeric) | CC(=CCOC1=CC=C(C=C1)C=CCO)CO |
InChI | InChI=1S/C14H18O3/c1-12(11-16)8-10-17-14-6-4-13(5-7-14)3-2-9-15/h2-8,15-16H,9-11H2,1H3 |
InChI Key | HBYDSAUNWMQLKR-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C14H18O3 |
Molecular Weight | 234.29 g/mol |
Exact Mass | 234.125594432 g/mol |
Topological Polar Surface Area (TPSA) | 49.70 Ų |
XlogP | 1.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2039 | P27338 | Monoamine oxidase B | 95.79% | 92.51% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.92% | 96.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.92% | 91.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.01% | 99.17% |
CHEMBL4208 | P20618 | Proteasome component C5 | 89.84% | 90.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.72% | 86.33% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 89.30% | 91.71% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.59% | 96.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.77% | 94.73% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 85.39% | 96.12% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 83.82% | 90.24% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.29% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Zanthoxylum integrifoliolum |
Zanthoxylum schinifolium |
PubChem | 163014040 |
LOTUS | LTS0101159 |
wikiData | Q105025540 |