4-[(3S)-4-hydroxy-3-methylbutoxy]benzoic acid
Internal ID | b4c09ed9-c529-4aaf-a8b2-6d0c98372a7a |
Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzoic acids and derivatives > Benzoic acids |
IUPAC Name | 4-[(3S)-4-hydroxy-3-methylbutoxy]benzoic acid |
SMILES (Canonical) | CC(CCOC1=CC=C(C=C1)C(=O)O)CO |
SMILES (Isomeric) | C[C@@H](CCOC1=CC=C(C=C1)C(=O)O)CO |
InChI | InChI=1S/C12H16O4/c1-9(8-13)6-7-16-11-4-2-10(3-5-11)12(14)15/h2-5,9,13H,6-8H2,1H3,(H,14,15)/t9-/m0/s1 |
InChI Key | CJYWRXWBFZXCDS-VIFPVBQESA-N |
Popularity | 0 references in papers |
Molecular Formula | C12H16O4 |
Molecular Weight | 224.25 g/mol |
Exact Mass | 224.10485899 g/mol |
Topological Polar Surface Area (TPSA) | 66.80 Ų |
XlogP | 2.70 |
There are no found synonyms. |
![2D Structure of 4-[(3S)-4-hydroxy-3-methylbutoxy]benzoic acid 2D Structure of 4-[(3S)-4-hydroxy-3-methylbutoxy]benzoic acid](https://plantaedb.com/storage/docs/compounds/2023/11/4-3s-4-hydroxy-3-methylbutoxybenzoic-acid.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.42% | 99.17% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 92.69% | 94.62% |
CHEMBL4208 | P20618 | Proteasome component C5 | 92.22% | 90.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.08% | 96.09% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 89.80% | 89.34% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.04% | 86.33% |
CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 86.87% | 100.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.57% | 96.00% |
CHEMBL2581 | P07339 | Cathepsin D | 85.52% | 98.95% |
CHEMBL1907 | P15144 | Aminopeptidase N | 84.66% | 93.31% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.46% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.38% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Turraeanthus africanus |
PubChem | 163013653 |
LOTUS | LTS0072346 |
wikiData | Q104961960 |