4-(3-Hydroxyprop-1-enyl)phenol
| Internal ID | accb3c71-a021-4b4c-acd0-8084112b10f3 |
| Taxonomy | Phenylpropanoids and polyketides > Cinnamyl alcohols |
| IUPAC Name | 4-(3-hydroxyprop-1-enyl)phenol |
| SMILES (Canonical) | C1=CC(=CC=C1C=CCO)O |
| SMILES (Isomeric) | C1=CC(=CC=C1C=CCO)O |
| InChI | InChI=1S/C9H10O2/c10-7-1-2-8-3-5-9(11)6-4-8/h1-6,10-11H,7H2 |
| InChI Key | PTNLHDGQWUGONS-UHFFFAOYSA-N |
| Popularity | 1,121 references in papers |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.17 g/mol |
| Exact Mass | 150.068079557 g/mol |
| Topological Polar Surface Area (TPSA) | 40.50 Ų |
| XlogP | 1.30 |
| Phenol, 4-(3-hydroxy-1-propenyl)- |
| MFCD02169461 |
| p-Cumaric alcohol; p-Hydroxycinnamic alcohol |
| p-hydroxy cinnamyl alcohol |
| TimTec1_004832 |
| Oprea1_369026 |
| 3-(4-hydroxyphenyl)-2-propenol |
| PTNLHDGQWUGONS-UHFFFAOYSA-N |
| AKOS017404971 |
| SY203874 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL242 | Q92731 | Estrogen receptor beta | 95.65% | 98.35% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.38% | 91.11% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 92.32% | 91.71% |
| CHEMBL3194 | P02766 | Transthyretin | 85.87% | 90.71% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.29% | 96.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.03% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.75% | 86.33% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.76% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Alpinia galanga |
| Alpinia officinarum |
| Rhodiola rosea |
| Solanum lycopersicum |
| PubChem | 94274 |
| LOTUS | LTS0037655 |
| wikiData | Q27103667 |