4-[3-(5-Hydroxy-2-methoxyphenyl)propyl]-2-methoxyphenol
Internal ID | 680f17ae-bf47-4269-9375-68f3ccb4f221 |
Taxonomy | Phenylpropanoids and polyketides > Linear 1,3-diarylpropanoids > Cinnamylphenols |
IUPAC Name | 4-[3-(5-hydroxy-2-methoxyphenyl)propyl]-2-methoxyphenol |
SMILES (Canonical) | COC1=C(C=C(C=C1)O)CCCC2=CC(=C(C=C2)O)OC |
SMILES (Isomeric) | COC1=C(C=C(C=C1)O)CCCC2=CC(=C(C=C2)O)OC |
InChI | InChI=1S/C17H20O4/c1-20-16-9-7-14(18)11-13(16)5-3-4-12-6-8-15(19)17(10-12)21-2/h6-11,18-19H,3-5H2,1-2H3 |
InChI Key | GDFQDNKQRITJNI-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C17H20O4 |
Molecular Weight | 288.34 g/mol |
Exact Mass | 288.13615911 g/mol |
Topological Polar Surface Area (TPSA) | 58.90 Ų |
XlogP | 3.90 |
There are no found synonyms. |
![2D Structure of 4-[3-(5-Hydroxy-2-methoxyphenyl)propyl]-2-methoxyphenol 2D Structure of 4-[3-(5-Hydroxy-2-methoxyphenyl)propyl]-2-methoxyphenol](https://plantaedb.com/storage/docs/compounds/2023/11/4-3-5-hydroxy-2-methoxyphenylpropyl-2-methoxyphenol.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.96% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.94% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 94.35% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.22% | 99.17% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 92.78% | 90.20% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.93% | 86.33% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 91.92% | 95.17% |
CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 90.65% | 96.09% |
CHEMBL2535 | P11166 | Glucose transporter | 88.23% | 98.75% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 87.11% | 89.62% |
CHEMBL3194 | P02766 | Transthyretin | 85.78% | 90.71% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.63% | 95.89% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.62% | 96.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.76% | 94.45% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.75% | 94.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.33% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.27% | 90.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.96% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Broussonetia papyrifera |
PubChem | 162971055 |
LOTUS | LTS0030400 |
wikiData | Q105006688 |