4-[3-[3-(4-Hydroxyphenyl)propoxy]propyl]phenol
| Internal ID | 7e1b9462-e7e5-4dbe-9000-43d65fc45aa6 |
| Taxonomy | Benzenoids > Phenols > 1-hydroxy-2-unsubstituted benzenoids |
| IUPAC Name | 4-[3-[3-(4-hydroxyphenyl)propoxy]propyl]phenol |
| SMILES (Canonical) | C1=CC(=CC=C1CCCOCCCC2=CC=C(C=C2)O)O |
| SMILES (Isomeric) | C1=CC(=CC=C1CCCOCCCC2=CC=C(C=C2)O)O |
| InChI | InChI=1S/C18H22O3/c19-17-9-5-15(6-10-17)3-1-13-21-14-2-4-16-7-11-18(20)12-8-16/h5-12,19-20H,1-4,13-14H2 |
| InChI Key | HWKLKZOSWWIGTL-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.15689456 g/mol |
| Topological Polar Surface Area (TPSA) | 49.70 Ų |
| XlogP | 4.00 |
| There are no found synonyms. |
![2D Structure of 4-[3-[3-(4-Hydroxyphenyl)propoxy]propyl]phenol](https://plantaedb.com/storage/docs/compounds/2023/11/4-3-3-4-hydroxyphenylpropoxypropylphenol.jpg "2D Structure of 4-[3-[3-(4-Hydroxyphenyl)propoxy]propyl]phenol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 92.13% | 98.95% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 92.07% | 94.62% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 91.94% | 98.35% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.45% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.07% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.67% | 99.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.00% | 94.45% |
| CHEMBL3230 | O95977 | Sphingosine 1-phosphate receptor Edg-6 | 83.97% | 94.01% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 83.96% | 91.71% |
| CHEMBL3194 | P02766 | Transthyretin | 81.51% | 90.71% |
| CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 81.15% | 96.37% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.93% | 95.89% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 80.24% | 85.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.14% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Spiranthes vernalis |
| PubChem | 91202108 |
| LOTUS | LTS0105857 |
| wikiData | Q105034684 |