4-[2-[5-(2-Hydroxypropyl)-2-methoxyphenyl]prop-2-enyl]phenol
| Internal ID | 0ed6cacc-0004-4ecf-8cf6-5f5c37f07fe2 |
| Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
| IUPAC Name | 4-[2-[5-(2-hydroxypropyl)-2-methoxyphenyl]prop-2-enyl]phenol |
| SMILES (Canonical) | CC(CC1=CC(=C(C=C1)OC)C(=C)CC2=CC=C(C=C2)O)O |
| SMILES (Isomeric) | CC(CC1=CC(=C(C=C1)OC)C(=C)CC2=CC=C(C=C2)O)O |
| InChI | InChI=1S/C19H22O3/c1-13(10-15-4-7-17(21)8-5-15)18-12-16(11-14(2)20)6-9-19(18)22-3/h4-9,12,14,20-21H,1,10-11H2,2-3H3 |
| InChI Key | ALWHQQHJMXYJQW-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.40 g/mol |
| Exact Mass | 298.15689456 g/mol |
| Topological Polar Surface Area (TPSA) | 49.70 Ų |
| XlogP | 4.50 |
| There are no found synonyms. |
![2D Structure of 4-[2-[5-(2-Hydroxypropyl)-2-methoxyphenyl]prop-2-enyl]phenol](https://plantaedb.com/storage/docs/compounds/2023/11/4-2-5-2-hydroxypropyl-2-methoxyphenylprop-2-enylphenol.jpg "2D Structure of 4-[2-[5-(2-Hydroxypropyl)-2-methoxyphenyl]prop-2-enyl]phenol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 97.21% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.66% | 96.09% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 96.32% | 90.20% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.05% | 85.14% |
| CHEMBL2535 | P11166 | Glucose transporter | 92.87% | 98.75% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.07% | 94.45% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.36% | 99.17% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.29% | 95.89% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 86.74% | 83.82% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.53% | 86.33% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.50% | 90.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.36% | 95.89% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.27% | 91.11% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.09% | 95.50% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.89% | 94.00% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 84.77% | 90.24% |
| CHEMBL240 | Q12809 | HERG | 83.52% | 89.76% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.32% | 95.56% |
| CHEMBL301 | P24941 | Cyclin-dependent kinase 2 | 82.07% | 91.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Krameria erecta |
| Krameria lanceolata |
| PubChem | 14352598 |
| LOTUS | LTS0130815 |
| wikiData | Q104914401 |