4-[2-(2,6-Dimethoxy-4-prop-2-enylphenoxy)propyl]-2-methoxyphenol
Internal ID | 99813ad3-29ca-4dfc-9469-902d4eca4af3 |
Taxonomy | Benzenoids > Phenols > Methoxyphenols |
IUPAC Name | 4-[2-(2,6-dimethoxy-4-prop-2-enylphenoxy)propyl]-2-methoxyphenol |
SMILES (Canonical) | CC(CC1=CC(=C(C=C1)O)OC)OC2=C(C=C(C=C2OC)CC=C)OC |
SMILES (Isomeric) | CC(CC1=CC(=C(C=C1)O)OC)OC2=C(C=C(C=C2OC)CC=C)OC |
InChI | InChI=1S/C21H26O5/c1-6-7-15-12-19(24-4)21(20(13-15)25-5)26-14(2)10-16-8-9-17(22)18(11-16)23-3/h6,8-9,11-14,22H,1,7,10H2,2-5H3 |
InChI Key | ASBSHOMCYZRGRD-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H26O5 |
Molecular Weight | 358.40 g/mol |
Exact Mass | 358.17802393 g/mol |
Topological Polar Surface Area (TPSA) | 57.20 Ų |
XlogP | 4.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.66% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.76% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 94.47% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.12% | 99.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.59% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.37% | 95.56% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 89.96% | 95.17% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 89.95% | 90.24% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 89.89% | 90.20% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.81% | 99.15% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 89.74% | 89.62% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.41% | 86.33% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.82% | 95.50% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.84% | 90.00% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 80.46% | 89.44% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Myristica fragrans |
PubChem | 21770236 |
LOTUS | LTS0151416 |
wikiData | Q104917727 |